mirror of
https://github.com/openfaas/faas.git
synced 2025-06-25 00:03:24 +00:00
Refreshed / updated vendor dependencies Tested with "make". Signed-off-by: Alex Ellis (OpenFaaS Ltd) <alexellis2@gmail.com>
3941 lines
99 KiB
Go
3941 lines
99 KiB
Go
// Copyright 2012-2019 The NATS Authors
|
|
// Licensed under the Apache License, Version 2.0 (the "License");
|
|
// you may not use this file except in compliance with the License.
|
|
// You may obtain a copy of the License at
|
|
//
|
|
// http://www.apache.org/licenses/LICENSE-2.0
|
|
//
|
|
// Unless required by applicable law or agreed to in writing, software
|
|
// distributed under the License is distributed on an "AS IS" BASIS,
|
|
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
// See the License for the specific language governing permissions and
|
|
// limitations under the License.
|
|
|
|
// A Go client for the NATS messaging system (https://nats.io).
|
|
package nats
|
|
|
|
import (
|
|
"bufio"
|
|
"bytes"
|
|
"crypto/tls"
|
|
"crypto/x509"
|
|
"encoding/base64"
|
|
"encoding/json"
|
|
"errors"
|
|
"fmt"
|
|
"io"
|
|
"io/ioutil"
|
|
"math/rand"
|
|
"net"
|
|
"net/url"
|
|
"regexp"
|
|
"runtime"
|
|
"strconv"
|
|
"strings"
|
|
"sync"
|
|
"sync/atomic"
|
|
"time"
|
|
|
|
"github.com/nats-io/go-nats/util"
|
|
"github.com/nats-io/nkeys"
|
|
"github.com/nats-io/nuid"
|
|
)
|
|
|
|
// Default Constants
|
|
const (
|
|
Version = "1.7.2"
|
|
DefaultURL = "nats://localhost:4222"
|
|
DefaultPort = 4222
|
|
DefaultMaxReconnect = 60
|
|
DefaultReconnectWait = 2 * time.Second
|
|
DefaultTimeout = 2 * time.Second
|
|
DefaultPingInterval = 2 * time.Minute
|
|
DefaultMaxPingOut = 2
|
|
DefaultMaxChanLen = 8192 // 8k
|
|
DefaultReconnectBufSize = 8 * 1024 * 1024 // 8MB
|
|
RequestChanLen = 8
|
|
DefaultDrainTimeout = 30 * time.Second
|
|
LangString = "go"
|
|
)
|
|
|
|
const (
|
|
// STALE_CONNECTION is for detection and proper handling of stale connections.
|
|
STALE_CONNECTION = "stale connection"
|
|
|
|
// PERMISSIONS_ERR is for when nats server subject authorization has failed.
|
|
PERMISSIONS_ERR = "permissions violation"
|
|
|
|
// AUTHORIZATION_ERR is for when nats server user authorization has failed.
|
|
AUTHORIZATION_ERR = "authorization violation"
|
|
)
|
|
|
|
// Errors
|
|
var (
|
|
ErrConnectionClosed = errors.New("nats: connection closed")
|
|
ErrConnectionDraining = errors.New("nats: connection draining")
|
|
ErrDrainTimeout = errors.New("nats: draining connection timed out")
|
|
ErrConnectionReconnecting = errors.New("nats: connection reconnecting")
|
|
ErrSecureConnRequired = errors.New("nats: secure connection required")
|
|
ErrSecureConnWanted = errors.New("nats: secure connection not available")
|
|
ErrBadSubscription = errors.New("nats: invalid subscription")
|
|
ErrTypeSubscription = errors.New("nats: invalid subscription type")
|
|
ErrBadSubject = errors.New("nats: invalid subject")
|
|
ErrSlowConsumer = errors.New("nats: slow consumer, messages dropped")
|
|
ErrTimeout = errors.New("nats: timeout")
|
|
ErrBadTimeout = errors.New("nats: timeout invalid")
|
|
ErrAuthorization = errors.New("nats: authorization violation")
|
|
ErrNoServers = errors.New("nats: no servers available for connection")
|
|
ErrJsonParse = errors.New("nats: connect message, json parse error")
|
|
ErrChanArg = errors.New("nats: argument needs to be a channel type")
|
|
ErrMaxPayload = errors.New("nats: maximum payload exceeded")
|
|
ErrMaxMessages = errors.New("nats: maximum messages delivered")
|
|
ErrSyncSubRequired = errors.New("nats: illegal call on an async subscription")
|
|
ErrMultipleTLSConfigs = errors.New("nats: multiple tls.Configs not allowed")
|
|
ErrNoInfoReceived = errors.New("nats: protocol exception, INFO not received")
|
|
ErrReconnectBufExceeded = errors.New("nats: outbound buffer limit exceeded")
|
|
ErrInvalidConnection = errors.New("nats: invalid connection")
|
|
ErrInvalidMsg = errors.New("nats: invalid message or message nil")
|
|
ErrInvalidArg = errors.New("nats: invalid argument")
|
|
ErrInvalidContext = errors.New("nats: invalid context")
|
|
ErrNoDeadlineContext = errors.New("nats: context requires a deadline")
|
|
ErrNoEchoNotSupported = errors.New("nats: no echo option not supported by this server")
|
|
ErrClientIDNotSupported = errors.New("nats: client ID not supported by this server")
|
|
ErrUserButNoSigCB = errors.New("nats: user callback defined without a signature handler")
|
|
ErrNkeyButNoSigCB = errors.New("nats: nkey defined without a signature handler")
|
|
ErrNoUserCB = errors.New("nats: user callback not defined")
|
|
ErrNkeyAndUser = errors.New("nats: user callback and nkey defined")
|
|
ErrNkeysNotSupported = errors.New("nats: nkeys not supported by the server")
|
|
ErrStaleConnection = errors.New("nats: " + STALE_CONNECTION)
|
|
ErrTokenAlreadySet = errors.New("nats: token and token handler both set")
|
|
)
|
|
|
|
// GetDefaultOptions returns default configuration options for the client.
|
|
func GetDefaultOptions() Options {
|
|
return Options{
|
|
AllowReconnect: true,
|
|
MaxReconnect: DefaultMaxReconnect,
|
|
ReconnectWait: DefaultReconnectWait,
|
|
Timeout: DefaultTimeout,
|
|
PingInterval: DefaultPingInterval,
|
|
MaxPingsOut: DefaultMaxPingOut,
|
|
SubChanLen: DefaultMaxChanLen,
|
|
ReconnectBufSize: DefaultReconnectBufSize,
|
|
DrainTimeout: DefaultDrainTimeout,
|
|
}
|
|
}
|
|
|
|
// DEPRECATED: Use GetDefaultOptions() instead.
|
|
// DefaultOptions is not safe for use by multiple clients.
|
|
// For details see #308.
|
|
var DefaultOptions = GetDefaultOptions()
|
|
|
|
// Status represents the state of the connection.
|
|
type Status int
|
|
|
|
const (
|
|
DISCONNECTED = Status(iota)
|
|
CONNECTED
|
|
CLOSED
|
|
RECONNECTING
|
|
CONNECTING
|
|
DRAINING_SUBS
|
|
DRAINING_PUBS
|
|
)
|
|
|
|
// ConnHandler is used for asynchronous events such as
|
|
// disconnected and closed connections.
|
|
type ConnHandler func(*Conn)
|
|
|
|
// ErrHandler is used to process asynchronous errors encountered
|
|
// while processing inbound messages.
|
|
type ErrHandler func(*Conn, *Subscription, error)
|
|
|
|
// UserJWTHandler is used to fetch and return the account signed
|
|
// JWT for this user.
|
|
type UserJWTHandler func() (string, error)
|
|
|
|
// SignatureHandler is used to sign a nonce from the server while
|
|
// authenticating with nkeys. The user should sign the nonce and
|
|
// return the base64 encoded signature.
|
|
type SignatureHandler func([]byte) ([]byte, error)
|
|
|
|
// AuthTokenHandler is used to generate a new token.
|
|
type AuthTokenHandler func() string
|
|
|
|
// asyncCB is used to preserve order for async callbacks.
|
|
type asyncCB struct {
|
|
f func()
|
|
next *asyncCB
|
|
}
|
|
|
|
type asyncCallbacksHandler struct {
|
|
mu sync.Mutex
|
|
cond *sync.Cond
|
|
head *asyncCB
|
|
tail *asyncCB
|
|
}
|
|
|
|
// Option is a function on the options for a connection.
|
|
type Option func(*Options) error
|
|
|
|
// CustomDialer can be used to specify any dialer, not necessarily
|
|
// a *net.Dialer.
|
|
type CustomDialer interface {
|
|
Dial(network, address string) (net.Conn, error)
|
|
}
|
|
|
|
// Options can be used to create a customized connection.
|
|
type Options struct {
|
|
|
|
// Url represents a single NATS server url to which the client
|
|
// will be connecting. If the Servers option is also set, it
|
|
// then becomes the first server in the Servers array.
|
|
Url string
|
|
|
|
// Servers is a configured set of servers which this client
|
|
// will use when attempting to connect.
|
|
Servers []string
|
|
|
|
// NoRandomize configures whether we will randomize the
|
|
// server pool.
|
|
NoRandomize bool
|
|
|
|
// NoEcho configures whether the server will echo back messages
|
|
// that are sent on this connection if we also have matching subscriptions.
|
|
// Note this is supported on servers >= version 1.2. Proto 1 or greater.
|
|
NoEcho bool
|
|
|
|
// Name is an optional name label which will be sent to the server
|
|
// on CONNECT to identify the client.
|
|
Name string
|
|
|
|
// Verbose signals the server to send an OK ack for commands
|
|
// successfully processed by the server.
|
|
Verbose bool
|
|
|
|
// Pedantic signals the server whether it should be doing further
|
|
// validation of subjects.
|
|
Pedantic bool
|
|
|
|
// Secure enables TLS secure connections that skip server
|
|
// verification by default. NOT RECOMMENDED.
|
|
Secure bool
|
|
|
|
// TLSConfig is a custom TLS configuration to use for secure
|
|
// transports.
|
|
TLSConfig *tls.Config
|
|
|
|
// AllowReconnect enables reconnection logic to be used when we
|
|
// encounter a disconnect from the current server.
|
|
AllowReconnect bool
|
|
|
|
// MaxReconnect sets the number of reconnect attempts that will be
|
|
// tried before giving up. If negative, then it will never give up
|
|
// trying to reconnect.
|
|
MaxReconnect int
|
|
|
|
// ReconnectWait sets the time to backoff after attempting a reconnect
|
|
// to a server that we were already connected to previously.
|
|
ReconnectWait time.Duration
|
|
|
|
// Timeout sets the timeout for a Dial operation on a connection.
|
|
Timeout time.Duration
|
|
|
|
// DrainTimeout sets the timeout for a Drain Operation to complete.
|
|
DrainTimeout time.Duration
|
|
|
|
// FlusherTimeout is the maximum time to wait for write operations
|
|
// to the underlying connection to complete (including the flusher loop).
|
|
FlusherTimeout time.Duration
|
|
|
|
// PingInterval is the period at which the client will be sending ping
|
|
// commands to the server, disabled if 0 or negative.
|
|
PingInterval time.Duration
|
|
|
|
// MaxPingsOut is the maximum number of pending ping commands that can
|
|
// be awaiting a response before raising an ErrStaleConnection error.
|
|
MaxPingsOut int
|
|
|
|
// ClosedCB sets the closed handler that is called when a client will
|
|
// no longer be connected.
|
|
ClosedCB ConnHandler
|
|
|
|
// DisconnectedCB sets the disconnected handler that is called
|
|
// whenever the connection is disconnected.
|
|
DisconnectedCB ConnHandler
|
|
|
|
// ReconnectedCB sets the reconnected handler called whenever
|
|
// the connection is successfully reconnected.
|
|
ReconnectedCB ConnHandler
|
|
|
|
// DiscoveredServersCB sets the callback that is invoked whenever a new
|
|
// server has joined the cluster.
|
|
DiscoveredServersCB ConnHandler
|
|
|
|
// AsyncErrorCB sets the async error handler (e.g. slow consumer errors)
|
|
AsyncErrorCB ErrHandler
|
|
|
|
// ReconnectBufSize is the size of the backing bufio during reconnect.
|
|
// Once this has been exhausted publish operations will return an error.
|
|
ReconnectBufSize int
|
|
|
|
// SubChanLen is the size of the buffered channel used between the socket
|
|
// Go routine and the message delivery for SyncSubscriptions.
|
|
// NOTE: This does not affect AsyncSubscriptions which are
|
|
// dictated by PendingLimits()
|
|
SubChanLen int
|
|
|
|
// UserJWT sets the callback handler that will fetch a user's JWT.
|
|
UserJWT UserJWTHandler
|
|
|
|
// Nkey sets the public nkey that will be used to authenticate
|
|
// when connecting to the server. UserJWT and Nkey are mutually exclusive
|
|
// and if defined, UserJWT will take precedence.
|
|
Nkey string
|
|
|
|
// SignatureCB designates the function used to sign the nonce
|
|
// presented from the server.
|
|
SignatureCB SignatureHandler
|
|
|
|
// User sets the username to be used when connecting to the server.
|
|
User string
|
|
|
|
// Password sets the password to be used when connecting to a server.
|
|
Password string
|
|
|
|
// Token sets the token to be used when connecting to a server.
|
|
Token string
|
|
|
|
// TokenHandler designates the function used to generate the token to be used when connecting to a server.
|
|
TokenHandler AuthTokenHandler
|
|
|
|
// Dialer allows a custom net.Dialer when forming connections.
|
|
// DEPRECATED: should use CustomDialer instead.
|
|
Dialer *net.Dialer
|
|
|
|
// CustomDialer allows to specify a custom dialer (not necessarily
|
|
// a *net.Dialer).
|
|
CustomDialer CustomDialer
|
|
|
|
// UseOldRequestStyle forces the old method of Requests that utilize
|
|
// a new Inbox and a new Subscription for each request.
|
|
UseOldRequestStyle bool
|
|
}
|
|
|
|
const (
|
|
// Scratch storage for assembling protocol headers
|
|
scratchSize = 512
|
|
|
|
// The size of the bufio reader/writer on top of the socket.
|
|
defaultBufSize = 32768
|
|
|
|
// The buffered size of the flush "kick" channel
|
|
flushChanSize = 1024
|
|
|
|
// Default server pool size
|
|
srvPoolSize = 4
|
|
|
|
// NUID size
|
|
nuidSize = 22
|
|
|
|
// Default port used if none is specified in given URL(s)
|
|
defaultPortString = "4222"
|
|
)
|
|
|
|
// A Conn represents a bare connection to a nats-server.
|
|
// It can send and receive []byte payloads.
|
|
type Conn struct {
|
|
// Keep all members for which we use atomic at the beginning of the
|
|
// struct and make sure they are all 64bits (or use padding if necessary).
|
|
// atomic.* functions crash on 32bit machines if operand is not aligned
|
|
// at 64bit. See https://github.com/golang/go/issues/599
|
|
Statistics
|
|
mu sync.Mutex
|
|
// Opts holds the configuration of the Conn.
|
|
// Modifying the configuration of a running Conn is a race.
|
|
Opts Options
|
|
wg sync.WaitGroup
|
|
srvPool []*srv
|
|
current *srv
|
|
urls map[string]struct{} // Keep track of all known URLs (used by processInfo)
|
|
conn net.Conn
|
|
bw *bufio.Writer
|
|
pending *bytes.Buffer
|
|
fch chan struct{}
|
|
info serverInfo
|
|
ssid int64
|
|
subsMu sync.RWMutex
|
|
subs map[int64]*Subscription
|
|
ach *asyncCallbacksHandler
|
|
pongs []chan struct{}
|
|
scratch [scratchSize]byte
|
|
status Status
|
|
initc bool // true if the connection is performing the initial connect
|
|
err error
|
|
ps *parseState
|
|
ptmr *time.Timer
|
|
pout int
|
|
|
|
// New style response handler
|
|
respSub string // The wildcard subject
|
|
respMux *Subscription // A single response subscription
|
|
respMap map[string]chan *Msg // Request map for the response msg channels
|
|
respSetup sync.Once // Ensures response subscription occurs once
|
|
respRand *rand.Rand // Used for generating suffix.
|
|
}
|
|
|
|
// A Subscription represents interest in a given subject.
|
|
type Subscription struct {
|
|
mu sync.Mutex
|
|
sid int64
|
|
|
|
// Subject that represents this subscription. This can be different
|
|
// than the received subject inside a Msg if this is a wildcard.
|
|
Subject string
|
|
|
|
// Optional queue group name. If present, all subscriptions with the
|
|
// same name will form a distributed queue, and each message will
|
|
// only be processed by one member of the group.
|
|
Queue string
|
|
|
|
delivered uint64
|
|
max uint64
|
|
conn *Conn
|
|
mcb MsgHandler
|
|
mch chan *Msg
|
|
closed bool
|
|
sc bool
|
|
connClosed bool
|
|
|
|
// Type of Subscription
|
|
typ SubscriptionType
|
|
|
|
// Async linked list
|
|
pHead *Msg
|
|
pTail *Msg
|
|
pCond *sync.Cond
|
|
|
|
// Pending stats, async subscriptions, high-speed etc.
|
|
pMsgs int
|
|
pBytes int
|
|
pMsgsMax int
|
|
pBytesMax int
|
|
pMsgsLimit int
|
|
pBytesLimit int
|
|
dropped int
|
|
}
|
|
|
|
// Msg is a structure used by Subscribers and PublishMsg().
|
|
type Msg struct {
|
|
Subject string
|
|
Reply string
|
|
Data []byte
|
|
Sub *Subscription
|
|
next *Msg
|
|
barrier *barrierInfo
|
|
}
|
|
|
|
type barrierInfo struct {
|
|
refs int64
|
|
f func()
|
|
}
|
|
|
|
// Tracks various stats received and sent on this connection,
|
|
// including counts for messages and bytes.
|
|
type Statistics struct {
|
|
InMsgs uint64
|
|
OutMsgs uint64
|
|
InBytes uint64
|
|
OutBytes uint64
|
|
Reconnects uint64
|
|
}
|
|
|
|
// Tracks individual backend servers.
|
|
type srv struct {
|
|
url *url.URL
|
|
didConnect bool
|
|
reconnects int
|
|
lastAttempt time.Time
|
|
isImplicit bool
|
|
tlsName string
|
|
}
|
|
|
|
type serverInfo struct {
|
|
Id string `json:"server_id"`
|
|
Host string `json:"host"`
|
|
Port uint `json:"port"`
|
|
Version string `json:"version"`
|
|
AuthRequired bool `json:"auth_required"`
|
|
TLSRequired bool `json:"tls_required"`
|
|
MaxPayload int64 `json:"max_payload"`
|
|
ConnectURLs []string `json:"connect_urls,omitempty"`
|
|
Proto int `json:"proto,omitempty"`
|
|
CID uint64 `json:"client_id,omitempty"`
|
|
Nonce string `json:"nonce,omitempty"`
|
|
}
|
|
|
|
const (
|
|
// clientProtoZero is the original client protocol from 2009.
|
|
// http://nats.io/documentation/internals/nats-protocol/
|
|
/* clientProtoZero */ _ = iota
|
|
// clientProtoInfo signals a client can receive more then the original INFO block.
|
|
// This can be used to update clients on other cluster members, etc.
|
|
clientProtoInfo
|
|
)
|
|
|
|
type connectInfo struct {
|
|
Verbose bool `json:"verbose"`
|
|
Pedantic bool `json:"pedantic"`
|
|
UserJWT string `json:"jwt,omitempty"`
|
|
Nkey string `json:"nkey,omitempty"`
|
|
Signature string `json:"sig,omitempty"`
|
|
User string `json:"user,omitempty"`
|
|
Pass string `json:"pass,omitempty"`
|
|
Token string `json:"auth_token,omitempty"`
|
|
TLS bool `json:"tls_required"`
|
|
Name string `json:"name"`
|
|
Lang string `json:"lang"`
|
|
Version string `json:"version"`
|
|
Protocol int `json:"protocol"`
|
|
Echo bool `json:"echo"`
|
|
}
|
|
|
|
// MsgHandler is a callback function that processes messages delivered to
|
|
// asynchronous subscribers.
|
|
type MsgHandler func(msg *Msg)
|
|
|
|
// Connect will attempt to connect to the NATS system.
|
|
// The url can contain username/password semantics. e.g. nats://derek:pass@localhost:4222
|
|
// Comma separated arrays are also supported, e.g. urlA, urlB.
|
|
// Options start with the defaults but can be overridden.
|
|
func Connect(url string, options ...Option) (*Conn, error) {
|
|
opts := GetDefaultOptions()
|
|
opts.Servers = processUrlString(url)
|
|
for _, opt := range options {
|
|
if opt != nil {
|
|
if err := opt(&opts); err != nil {
|
|
return nil, err
|
|
}
|
|
}
|
|
}
|
|
return opts.Connect()
|
|
}
|
|
|
|
// Options that can be passed to Connect.
|
|
|
|
// Name is an Option to set the client name.
|
|
func Name(name string) Option {
|
|
return func(o *Options) error {
|
|
o.Name = name
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// Secure is an Option to enable TLS secure connections that skip server verification by default.
|
|
// Pass a TLS Configuration for proper TLS.
|
|
// NOTE: This should NOT be used in a production setting.
|
|
func Secure(tls ...*tls.Config) Option {
|
|
return func(o *Options) error {
|
|
o.Secure = true
|
|
// Use of variadic just simplifies testing scenarios. We only take the first one.
|
|
if len(tls) > 1 {
|
|
return ErrMultipleTLSConfigs
|
|
}
|
|
if len(tls) == 1 {
|
|
o.TLSConfig = tls[0]
|
|
}
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// RootCAs is a helper option to provide the RootCAs pool from a list of filenames.
|
|
// If Secure is not already set this will set it as well.
|
|
func RootCAs(file ...string) Option {
|
|
return func(o *Options) error {
|
|
pool := x509.NewCertPool()
|
|
for _, f := range file {
|
|
rootPEM, err := ioutil.ReadFile(f)
|
|
if err != nil || rootPEM == nil {
|
|
return fmt.Errorf("nats: error loading or parsing rootCA file: %v", err)
|
|
}
|
|
ok := pool.AppendCertsFromPEM(rootPEM)
|
|
if !ok {
|
|
return fmt.Errorf("nats: failed to parse root certificate from %q", f)
|
|
}
|
|
}
|
|
if o.TLSConfig == nil {
|
|
o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12}
|
|
}
|
|
o.TLSConfig.RootCAs = pool
|
|
o.Secure = true
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// ClientCert is a helper option to provide the client certificate from a file.
|
|
// If Secure is not already set this will set it as well.
|
|
func ClientCert(certFile, keyFile string) Option {
|
|
return func(o *Options) error {
|
|
cert, err := tls.LoadX509KeyPair(certFile, keyFile)
|
|
if err != nil {
|
|
return fmt.Errorf("nats: error loading client certificate: %v", err)
|
|
}
|
|
cert.Leaf, err = x509.ParseCertificate(cert.Certificate[0])
|
|
if err != nil {
|
|
return fmt.Errorf("nats: error parsing client certificate: %v", err)
|
|
}
|
|
if o.TLSConfig == nil {
|
|
o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12}
|
|
}
|
|
o.TLSConfig.Certificates = []tls.Certificate{cert}
|
|
o.Secure = true
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// NoReconnect is an Option to turn off reconnect behavior.
|
|
func NoReconnect() Option {
|
|
return func(o *Options) error {
|
|
o.AllowReconnect = false
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// DontRandomize is an Option to turn off randomizing the server pool.
|
|
func DontRandomize() Option {
|
|
return func(o *Options) error {
|
|
o.NoRandomize = true
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// NoEcho is an Option to turn off messages echoing back from a server.
|
|
// Note this is supported on servers >= version 1.2. Proto 1 or greater.
|
|
func NoEcho() Option {
|
|
return func(o *Options) error {
|
|
o.NoEcho = true
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// ReconnectWait is an Option to set the wait time between reconnect attempts.
|
|
func ReconnectWait(t time.Duration) Option {
|
|
return func(o *Options) error {
|
|
o.ReconnectWait = t
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// MaxReconnects is an Option to set the maximum number of reconnect attempts.
|
|
func MaxReconnects(max int) Option {
|
|
return func(o *Options) error {
|
|
o.MaxReconnect = max
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// PingInterval is an Option to set the period for client ping commands.
|
|
func PingInterval(t time.Duration) Option {
|
|
return func(o *Options) error {
|
|
o.PingInterval = t
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// MaxPingsOutstanding is an Option to set the maximum number of ping requests
|
|
// that can go un-answered by the server before closing the connection.
|
|
func MaxPingsOutstanding(max int) Option {
|
|
return func(o *Options) error {
|
|
o.MaxPingsOut = max
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// ReconnectBufSize sets the buffer size of messages kept while busy reconnecting.
|
|
func ReconnectBufSize(size int) Option {
|
|
return func(o *Options) error {
|
|
o.ReconnectBufSize = size
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// Timeout is an Option to set the timeout for Dial on a connection.
|
|
func Timeout(t time.Duration) Option {
|
|
return func(o *Options) error {
|
|
o.Timeout = t
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// FlusherTimeout is an Option to set the write (and flush) timeout on a connection.
|
|
func FlusherTimeout(t time.Duration) Option {
|
|
return func(o *Options) error {
|
|
o.FlusherTimeout = t
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// DrainTimeout is an Option to set the timeout for draining a connection.
|
|
func DrainTimeout(t time.Duration) Option {
|
|
return func(o *Options) error {
|
|
o.DrainTimeout = t
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// DisconnectHandler is an Option to set the disconnected handler.
|
|
func DisconnectHandler(cb ConnHandler) Option {
|
|
return func(o *Options) error {
|
|
o.DisconnectedCB = cb
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// ReconnectHandler is an Option to set the reconnected handler.
|
|
func ReconnectHandler(cb ConnHandler) Option {
|
|
return func(o *Options) error {
|
|
o.ReconnectedCB = cb
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// ClosedHandler is an Option to set the closed handler.
|
|
func ClosedHandler(cb ConnHandler) Option {
|
|
return func(o *Options) error {
|
|
o.ClosedCB = cb
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// DiscoveredServersHandler is an Option to set the new servers handler.
|
|
func DiscoveredServersHandler(cb ConnHandler) Option {
|
|
return func(o *Options) error {
|
|
o.DiscoveredServersCB = cb
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// ErrorHandler is an Option to set the async error handler.
|
|
func ErrorHandler(cb ErrHandler) Option {
|
|
return func(o *Options) error {
|
|
o.AsyncErrorCB = cb
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// UserInfo is an Option to set the username and password to
|
|
// use when not included directly in the URLs.
|
|
func UserInfo(user, password string) Option {
|
|
return func(o *Options) error {
|
|
o.User = user
|
|
o.Password = password
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// Token is an Option to set the token to use
|
|
// when a token is not included directly in the URLs
|
|
// and when a token handler is not provided.
|
|
func Token(token string) Option {
|
|
return func(o *Options) error {
|
|
if o.TokenHandler != nil {
|
|
return ErrTokenAlreadySet
|
|
}
|
|
o.Token = token
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// TokenHandler is an Option to set the token handler to use
|
|
// when a token is not included directly in the URLs
|
|
// and when a token is not set.
|
|
func TokenHandler(cb AuthTokenHandler) Option {
|
|
return func(o *Options) error {
|
|
if o.Token != "" {
|
|
return ErrTokenAlreadySet
|
|
}
|
|
o.TokenHandler = cb
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// UserCredentials is a convenience function that takes a filename
|
|
// for a user's JWT and a filename for the user's private Nkey seed.
|
|
func UserCredentials(userOrChainedFile string, seedFiles ...string) Option {
|
|
userCB := func() (string, error) {
|
|
return userFromFile(userOrChainedFile)
|
|
}
|
|
var keyFile string
|
|
if len(seedFiles) > 0 {
|
|
keyFile = seedFiles[0]
|
|
} else {
|
|
keyFile = userOrChainedFile
|
|
}
|
|
sigCB := func(nonce []byte) ([]byte, error) {
|
|
return sigHandler(nonce, keyFile)
|
|
}
|
|
return UserJWT(userCB, sigCB)
|
|
}
|
|
|
|
// UserJWT will set the callbacks to retrieve the user's JWT and
|
|
// the signature callback to sign the server nonce. This an the Nkey
|
|
// option are mutually exclusive.
|
|
func UserJWT(userCB UserJWTHandler, sigCB SignatureHandler) Option {
|
|
return func(o *Options) error {
|
|
if userCB == nil {
|
|
return ErrNoUserCB
|
|
}
|
|
if sigCB == nil {
|
|
return ErrUserButNoSigCB
|
|
}
|
|
o.UserJWT = userCB
|
|
o.SignatureCB = sigCB
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// Nkey will set the public Nkey and the signature callback to
|
|
// sign the server nonce.
|
|
func Nkey(pubKey string, sigCB SignatureHandler) Option {
|
|
return func(o *Options) error {
|
|
o.Nkey = pubKey
|
|
o.SignatureCB = sigCB
|
|
if pubKey != "" && sigCB == nil {
|
|
return ErrNkeyButNoSigCB
|
|
}
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// SyncQueueLen will set the maximum queue len for the internal
|
|
// channel used for SubscribeSync().
|
|
func SyncQueueLen(max int) Option {
|
|
return func(o *Options) error {
|
|
o.SubChanLen = max
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// Dialer is an Option to set the dialer which will be used when
|
|
// attempting to establish a connection.
|
|
// DEPRECATED: Should use CustomDialer instead.
|
|
func Dialer(dialer *net.Dialer) Option {
|
|
return func(o *Options) error {
|
|
o.Dialer = dialer
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// SetCustomDialer is an Option to set a custom dialer which will be
|
|
// used when attempting to establish a connection. If both Dialer
|
|
// and CustomDialer are specified, CustomDialer takes precedence.
|
|
func SetCustomDialer(dialer CustomDialer) Option {
|
|
return func(o *Options) error {
|
|
o.CustomDialer = dialer
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// UseOldRequestStyle is an Option to force usage of the old Request style.
|
|
func UseOldRequestStyle() Option {
|
|
return func(o *Options) error {
|
|
o.UseOldRequestStyle = true
|
|
return nil
|
|
}
|
|
}
|
|
|
|
// Handler processing
|
|
|
|
// SetDisconnectHandler will set the disconnect event handler.
|
|
func (nc *Conn) SetDisconnectHandler(dcb ConnHandler) {
|
|
if nc == nil {
|
|
return
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
nc.Opts.DisconnectedCB = dcb
|
|
}
|
|
|
|
// SetReconnectHandler will set the reconnect event handler.
|
|
func (nc *Conn) SetReconnectHandler(rcb ConnHandler) {
|
|
if nc == nil {
|
|
return
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
nc.Opts.ReconnectedCB = rcb
|
|
}
|
|
|
|
// SetDiscoveredServersHandler will set the discovered servers handler.
|
|
func (nc *Conn) SetDiscoveredServersHandler(dscb ConnHandler) {
|
|
if nc == nil {
|
|
return
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
nc.Opts.DiscoveredServersCB = dscb
|
|
}
|
|
|
|
// SetClosedHandler will set the reconnect event handler.
|
|
func (nc *Conn) SetClosedHandler(cb ConnHandler) {
|
|
if nc == nil {
|
|
return
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
nc.Opts.ClosedCB = cb
|
|
}
|
|
|
|
// SetErrorHandler will set the async error handler.
|
|
func (nc *Conn) SetErrorHandler(cb ErrHandler) {
|
|
if nc == nil {
|
|
return
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
nc.Opts.AsyncErrorCB = cb
|
|
}
|
|
|
|
// Process the url string argument to Connect.
|
|
// Return an array of urls, even if only one.
|
|
func processUrlString(url string) []string {
|
|
urls := strings.Split(url, ",")
|
|
for i, s := range urls {
|
|
urls[i] = strings.TrimSpace(s)
|
|
}
|
|
return urls
|
|
}
|
|
|
|
// Connect will attempt to connect to a NATS server with multiple options.
|
|
func (o Options) Connect() (*Conn, error) {
|
|
nc := &Conn{Opts: o}
|
|
|
|
// Some default options processing.
|
|
if nc.Opts.MaxPingsOut == 0 {
|
|
nc.Opts.MaxPingsOut = DefaultMaxPingOut
|
|
}
|
|
// Allow old default for channel length to work correctly.
|
|
if nc.Opts.SubChanLen == 0 {
|
|
nc.Opts.SubChanLen = DefaultMaxChanLen
|
|
}
|
|
// Default ReconnectBufSize
|
|
if nc.Opts.ReconnectBufSize == 0 {
|
|
nc.Opts.ReconnectBufSize = DefaultReconnectBufSize
|
|
}
|
|
// Ensure that Timeout is not 0
|
|
if nc.Opts.Timeout == 0 {
|
|
nc.Opts.Timeout = DefaultTimeout
|
|
}
|
|
|
|
// Check first for user jwt callback being defined and nkey.
|
|
if nc.Opts.UserJWT != nil && nc.Opts.Nkey != "" {
|
|
return nil, ErrNkeyAndUser
|
|
}
|
|
|
|
// Check if we have an nkey but no signature callback defined.
|
|
if nc.Opts.Nkey != "" && nc.Opts.SignatureCB == nil {
|
|
return nil, ErrNkeyButNoSigCB
|
|
}
|
|
|
|
// Allow custom Dialer for connecting using DialTimeout by default
|
|
if nc.Opts.Dialer == nil {
|
|
nc.Opts.Dialer = &net.Dialer{
|
|
Timeout: nc.Opts.Timeout,
|
|
}
|
|
}
|
|
|
|
if err := nc.setupServerPool(); err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
// Create the async callback handler.
|
|
nc.ach = &asyncCallbacksHandler{}
|
|
nc.ach.cond = sync.NewCond(&nc.ach.mu)
|
|
|
|
if err := nc.connect(); err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
// Spin up the async cb dispatcher on success
|
|
go nc.ach.asyncCBDispatcher()
|
|
|
|
return nc, nil
|
|
}
|
|
|
|
const (
|
|
_CRLF_ = "\r\n"
|
|
_EMPTY_ = ""
|
|
_SPC_ = " "
|
|
_PUB_P_ = "PUB "
|
|
)
|
|
|
|
const (
|
|
_OK_OP_ = "+OK"
|
|
_ERR_OP_ = "-ERR"
|
|
_PONG_OP_ = "PONG"
|
|
_INFO_OP_ = "INFO"
|
|
)
|
|
|
|
const (
|
|
conProto = "CONNECT %s" + _CRLF_
|
|
pingProto = "PING" + _CRLF_
|
|
pongProto = "PONG" + _CRLF_
|
|
subProto = "SUB %s %s %d" + _CRLF_
|
|
unsubProto = "UNSUB %d %s" + _CRLF_
|
|
okProto = _OK_OP_ + _CRLF_
|
|
)
|
|
|
|
// Return the currently selected server
|
|
func (nc *Conn) currentServer() (int, *srv) {
|
|
for i, s := range nc.srvPool {
|
|
if s == nil {
|
|
continue
|
|
}
|
|
if s == nc.current {
|
|
return i, s
|
|
}
|
|
}
|
|
return -1, nil
|
|
}
|
|
|
|
// Pop the current server and put onto the end of the list. Select head of list as long
|
|
// as number of reconnect attempts under MaxReconnect.
|
|
func (nc *Conn) selectNextServer() (*srv, error) {
|
|
i, s := nc.currentServer()
|
|
if i < 0 {
|
|
return nil, ErrNoServers
|
|
}
|
|
sp := nc.srvPool
|
|
num := len(sp)
|
|
copy(sp[i:num-1], sp[i+1:num])
|
|
maxReconnect := nc.Opts.MaxReconnect
|
|
if maxReconnect < 0 || s.reconnects < maxReconnect {
|
|
nc.srvPool[num-1] = s
|
|
} else {
|
|
nc.srvPool = sp[0 : num-1]
|
|
}
|
|
if len(nc.srvPool) <= 0 {
|
|
nc.current = nil
|
|
return nil, ErrNoServers
|
|
}
|
|
nc.current = nc.srvPool[0]
|
|
return nc.srvPool[0], nil
|
|
}
|
|
|
|
// Will assign the correct server to nc.current
|
|
func (nc *Conn) pickServer() error {
|
|
nc.current = nil
|
|
if len(nc.srvPool) <= 0 {
|
|
return ErrNoServers
|
|
}
|
|
|
|
for _, s := range nc.srvPool {
|
|
if s != nil {
|
|
nc.current = s
|
|
return nil
|
|
}
|
|
}
|
|
return ErrNoServers
|
|
}
|
|
|
|
const tlsScheme = "tls"
|
|
|
|
// Create the server pool using the options given.
|
|
// We will place a Url option first, followed by any
|
|
// Server Options. We will randomize the server pool unless
|
|
// the NoRandomize flag is set.
|
|
func (nc *Conn) setupServerPool() error {
|
|
nc.srvPool = make([]*srv, 0, srvPoolSize)
|
|
nc.urls = make(map[string]struct{}, srvPoolSize)
|
|
|
|
// Create srv objects from each url string in nc.Opts.Servers
|
|
// and add them to the pool.
|
|
for _, urlString := range nc.Opts.Servers {
|
|
if err := nc.addURLToPool(urlString, false, false); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
|
|
// Randomize if allowed to
|
|
if !nc.Opts.NoRandomize {
|
|
nc.shufflePool()
|
|
}
|
|
|
|
// Normally, if this one is set, Options.Servers should not be,
|
|
// but we always allowed that, so continue to do so.
|
|
if nc.Opts.Url != _EMPTY_ {
|
|
// Add to the end of the array
|
|
if err := nc.addURLToPool(nc.Opts.Url, false, false); err != nil {
|
|
return err
|
|
}
|
|
// Then swap it with first to guarantee that Options.Url is tried first.
|
|
last := len(nc.srvPool) - 1
|
|
if last > 0 {
|
|
nc.srvPool[0], nc.srvPool[last] = nc.srvPool[last], nc.srvPool[0]
|
|
}
|
|
} else if len(nc.srvPool) <= 0 {
|
|
// Place default URL if pool is empty.
|
|
if err := nc.addURLToPool(DefaultURL, false, false); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
|
|
// Check for Scheme hint to move to TLS mode.
|
|
for _, srv := range nc.srvPool {
|
|
if srv.url.Scheme == tlsScheme {
|
|
// FIXME(dlc), this is for all in the pool, should be case by case.
|
|
nc.Opts.Secure = true
|
|
if nc.Opts.TLSConfig == nil {
|
|
nc.Opts.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12}
|
|
}
|
|
}
|
|
}
|
|
|
|
return nc.pickServer()
|
|
}
|
|
|
|
// Helper function to return scheme
|
|
func (nc *Conn) connScheme() string {
|
|
if nc.Opts.Secure {
|
|
return tlsScheme
|
|
}
|
|
return "nats"
|
|
}
|
|
|
|
// Return true iff u.Hostname() is an IP address.
|
|
func hostIsIP(u *url.URL) bool {
|
|
return net.ParseIP(u.Hostname()) != nil
|
|
}
|
|
|
|
// addURLToPool adds an entry to the server pool
|
|
func (nc *Conn) addURLToPool(sURL string, implicit, saveTLSName bool) error {
|
|
if !strings.Contains(sURL, "://") {
|
|
sURL = fmt.Sprintf("%s://%s", nc.connScheme(), sURL)
|
|
}
|
|
var (
|
|
u *url.URL
|
|
err error
|
|
)
|
|
for i := 0; i < 2; i++ {
|
|
u, err = url.Parse(sURL)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
if u.Port() != "" {
|
|
break
|
|
}
|
|
// In case given URL is of the form "localhost:", just add
|
|
// the port number at the end, otherwise, add ":4222".
|
|
if sURL[len(sURL)-1] != ':' {
|
|
sURL += ":"
|
|
}
|
|
sURL += defaultPortString
|
|
}
|
|
|
|
var tlsName string
|
|
if implicit {
|
|
curl := nc.current.url
|
|
// Check to see if we do not have a url.User but current connected
|
|
// url does. If so copy over.
|
|
if u.User == nil && curl.User != nil {
|
|
u.User = curl.User
|
|
}
|
|
// We are checking to see if we have a secure connection and are
|
|
// adding an implicit server that just has an IP. If so we will remember
|
|
// the current hostname we are connected to.
|
|
if saveTLSName && hostIsIP(u) {
|
|
tlsName = curl.Hostname()
|
|
}
|
|
}
|
|
|
|
s := &srv{url: u, isImplicit: implicit, tlsName: tlsName}
|
|
nc.srvPool = append(nc.srvPool, s)
|
|
nc.urls[u.Host] = struct{}{}
|
|
return nil
|
|
}
|
|
|
|
// shufflePool swaps randomly elements in the server pool
|
|
func (nc *Conn) shufflePool() {
|
|
if len(nc.srvPool) <= 1 {
|
|
return
|
|
}
|
|
source := rand.NewSource(time.Now().UnixNano())
|
|
r := rand.New(source)
|
|
for i := range nc.srvPool {
|
|
j := r.Intn(i + 1)
|
|
nc.srvPool[i], nc.srvPool[j] = nc.srvPool[j], nc.srvPool[i]
|
|
}
|
|
}
|
|
|
|
func (nc *Conn) newBuffer() *bufio.Writer {
|
|
var w io.Writer = nc.conn
|
|
if nc.Opts.FlusherTimeout > 0 {
|
|
w = &timeoutWriter{conn: nc.conn, timeout: nc.Opts.FlusherTimeout}
|
|
}
|
|
return bufio.NewWriterSize(w, defaultBufSize)
|
|
}
|
|
|
|
// createConn will connect to the server and wrap the appropriate
|
|
// bufio structures. It will do the right thing when an existing
|
|
// connection is in place.
|
|
func (nc *Conn) createConn() (err error) {
|
|
if nc.Opts.Timeout < 0 {
|
|
return ErrBadTimeout
|
|
}
|
|
if _, cur := nc.currentServer(); cur == nil {
|
|
return ErrNoServers
|
|
} else {
|
|
cur.lastAttempt = time.Now()
|
|
}
|
|
|
|
// We will auto-expand host names if they resolve to multiple IPs
|
|
hosts := map[string]struct{}{}
|
|
u := nc.current.url
|
|
|
|
if net.ParseIP(u.Hostname()) == nil {
|
|
addrs, _ := net.LookupHost(u.Hostname())
|
|
for _, addr := range addrs {
|
|
hosts[net.JoinHostPort(addr, u.Port())] = struct{}{}
|
|
}
|
|
}
|
|
// Fall back to what we were given.
|
|
if len(hosts) == 0 {
|
|
hosts[u.Host] = struct{}{}
|
|
}
|
|
|
|
// CustomDialer takes precedence. If not set, use Opts.Dialer which
|
|
// is set to a default *net.Dialer (in Connect()) if not explicitly
|
|
// set by the user.
|
|
dialer := nc.Opts.CustomDialer
|
|
if dialer == nil {
|
|
// We will copy and shorten the timeout if we have multiple hosts to try.
|
|
copyDialer := *nc.Opts.Dialer
|
|
copyDialer.Timeout = copyDialer.Timeout / time.Duration(len(hosts))
|
|
dialer = ©Dialer
|
|
}
|
|
|
|
for host := range hosts {
|
|
nc.conn, err = dialer.Dial("tcp", host)
|
|
if err == nil {
|
|
break
|
|
}
|
|
}
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// No clue why, but this stalls and kills performance on Mac (Mavericks).
|
|
// https://code.google.com/p/go/issues/detail?id=6930
|
|
//if ip, ok := nc.conn.(*net.TCPConn); ok {
|
|
// ip.SetReadBuffer(defaultBufSize)
|
|
//}
|
|
|
|
if nc.pending != nil && nc.bw != nil {
|
|
// Move to pending buffer.
|
|
nc.bw.Flush()
|
|
}
|
|
nc.bw = nc.newBuffer()
|
|
return nil
|
|
}
|
|
|
|
// makeTLSConn will wrap an existing Conn using TLS
|
|
func (nc *Conn) makeTLSConn() error {
|
|
// Allow the user to configure their own tls.Config structure.
|
|
var tlsCopy *tls.Config
|
|
if nc.Opts.TLSConfig != nil {
|
|
tlsCopy = util.CloneTLSConfig(nc.Opts.TLSConfig)
|
|
} else {
|
|
tlsCopy = &tls.Config{}
|
|
}
|
|
// If its blank we will override it with the current host
|
|
if tlsCopy.ServerName == _EMPTY_ {
|
|
if nc.current.tlsName != _EMPTY_ {
|
|
tlsCopy.ServerName = nc.current.tlsName
|
|
} else {
|
|
h, _, _ := net.SplitHostPort(nc.current.url.Host)
|
|
tlsCopy.ServerName = h
|
|
}
|
|
}
|
|
nc.conn = tls.Client(nc.conn, tlsCopy)
|
|
conn := nc.conn.(*tls.Conn)
|
|
if err := conn.Handshake(); err != nil {
|
|
return err
|
|
}
|
|
nc.bw = nc.newBuffer()
|
|
return nil
|
|
}
|
|
|
|
// waitForExits will wait for all socket watcher Go routines to
|
|
// be shutdown before proceeding.
|
|
func (nc *Conn) waitForExits() {
|
|
// Kick old flusher forcefully.
|
|
select {
|
|
case nc.fch <- struct{}{}:
|
|
default:
|
|
}
|
|
|
|
// Wait for any previous go routines.
|
|
nc.wg.Wait()
|
|
}
|
|
|
|
// Report the connected server's Url
|
|
func (nc *Conn) ConnectedUrl() string {
|
|
if nc == nil {
|
|
return _EMPTY_
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
if nc.status != CONNECTED {
|
|
return _EMPTY_
|
|
}
|
|
return nc.current.url.String()
|
|
}
|
|
|
|
// ConnectedAddr returns the connected server's IP
|
|
func (nc *Conn) ConnectedAddr() string {
|
|
if nc == nil {
|
|
return _EMPTY_
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
if nc.status != CONNECTED {
|
|
return _EMPTY_
|
|
}
|
|
return nc.conn.RemoteAddr().String()
|
|
}
|
|
|
|
// Report the connected server's Id
|
|
func (nc *Conn) ConnectedServerId() string {
|
|
if nc == nil {
|
|
return _EMPTY_
|
|
}
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
if nc.status != CONNECTED {
|
|
return _EMPTY_
|
|
}
|
|
return nc.info.Id
|
|
}
|
|
|
|
// Low level setup for structs, etc
|
|
func (nc *Conn) setup() {
|
|
nc.subs = make(map[int64]*Subscription)
|
|
nc.pongs = make([]chan struct{}, 0, 8)
|
|
|
|
nc.fch = make(chan struct{}, flushChanSize)
|
|
|
|
// Setup scratch outbound buffer for PUB
|
|
pub := nc.scratch[:len(_PUB_P_)]
|
|
copy(pub, _PUB_P_)
|
|
}
|
|
|
|
// Process a connected connection and initialize properly.
|
|
func (nc *Conn) processConnectInit() error {
|
|
|
|
// Set our deadline for the whole connect process
|
|
nc.conn.SetDeadline(time.Now().Add(nc.Opts.Timeout))
|
|
defer nc.conn.SetDeadline(time.Time{})
|
|
|
|
// Set our status to connecting.
|
|
nc.status = CONNECTING
|
|
|
|
// Process the INFO protocol received from the server
|
|
err := nc.processExpectedInfo()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// Send the CONNECT protocol along with the initial PING protocol.
|
|
// Wait for the PONG response (or any error that we get from the server).
|
|
err = nc.sendConnect()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// Reset the number of PING sent out
|
|
nc.pout = 0
|
|
|
|
// Start or reset Timer
|
|
if nc.Opts.PingInterval > 0 {
|
|
if nc.ptmr == nil {
|
|
nc.ptmr = time.AfterFunc(nc.Opts.PingInterval, nc.processPingTimer)
|
|
} else {
|
|
nc.ptmr.Reset(nc.Opts.PingInterval)
|
|
}
|
|
}
|
|
|
|
// Start the readLoop and flusher go routines, we will wait on both on a reconnect event.
|
|
nc.wg.Add(2)
|
|
go nc.readLoop()
|
|
go nc.flusher()
|
|
|
|
return nil
|
|
}
|
|
|
|
// Main connect function. Will connect to the nats-server
|
|
func (nc *Conn) connect() error {
|
|
var returnedErr error
|
|
|
|
// Create actual socket connection
|
|
// For first connect we walk all servers in the pool and try
|
|
// to connect immediately.
|
|
nc.mu.Lock()
|
|
nc.initc = true
|
|
// The pool may change inside the loop iteration due to INFO protocol.
|
|
for i := 0; i < len(nc.srvPool); i++ {
|
|
nc.current = nc.srvPool[i]
|
|
|
|
if err := nc.createConn(); err == nil {
|
|
// This was moved out of processConnectInit() because
|
|
// that function is now invoked from doReconnect() too.
|
|
nc.setup()
|
|
|
|
err = nc.processConnectInit()
|
|
|
|
if err == nil {
|
|
nc.srvPool[i].didConnect = true
|
|
nc.srvPool[i].reconnects = 0
|
|
returnedErr = nil
|
|
break
|
|
} else {
|
|
returnedErr = err
|
|
nc.mu.Unlock()
|
|
nc.close(DISCONNECTED, false)
|
|
nc.mu.Lock()
|
|
nc.current = nil
|
|
}
|
|
} else {
|
|
// Cancel out default connection refused, will trigger the
|
|
// No servers error conditional
|
|
if strings.Contains(err.Error(), "connection refused") {
|
|
returnedErr = nil
|
|
}
|
|
}
|
|
}
|
|
nc.initc = false
|
|
defer nc.mu.Unlock()
|
|
|
|
if returnedErr == nil && nc.status != CONNECTED {
|
|
returnedErr = ErrNoServers
|
|
}
|
|
return returnedErr
|
|
}
|
|
|
|
// This will check to see if the connection should be
|
|
// secure. This can be dictated from either end and should
|
|
// only be called after the INIT protocol has been received.
|
|
func (nc *Conn) checkForSecure() error {
|
|
// Check to see if we need to engage TLS
|
|
o := nc.Opts
|
|
|
|
// Check for mismatch in setups
|
|
if o.Secure && !nc.info.TLSRequired {
|
|
return ErrSecureConnWanted
|
|
} else if nc.info.TLSRequired && !o.Secure {
|
|
// Switch to Secure since server needs TLS.
|
|
o.Secure = true
|
|
}
|
|
|
|
// Need to rewrap with bufio
|
|
if o.Secure {
|
|
if err := nc.makeTLSConn(); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
return nil
|
|
}
|
|
|
|
// processExpectedInfo will look for the expected first INFO message
|
|
// sent when a connection is established. The lock should be held entering.
|
|
func (nc *Conn) processExpectedInfo() error {
|
|
|
|
c := &control{}
|
|
|
|
// Read the protocol
|
|
err := nc.readOp(c)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// The nats protocol should send INFO first always.
|
|
if c.op != _INFO_OP_ {
|
|
return ErrNoInfoReceived
|
|
}
|
|
|
|
// Parse the protocol
|
|
if err := nc.processInfo(c.args); err != nil {
|
|
return err
|
|
}
|
|
|
|
if nc.Opts.Nkey != "" && nc.info.Nonce == "" {
|
|
return ErrNkeysNotSupported
|
|
}
|
|
|
|
return nc.checkForSecure()
|
|
}
|
|
|
|
// Sends a protocol control message by queuing into the bufio writer
|
|
// and kicking the flush Go routine. These writes are protected.
|
|
func (nc *Conn) sendProto(proto string) {
|
|
nc.mu.Lock()
|
|
nc.bw.WriteString(proto)
|
|
nc.kickFlusher()
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// Generate a connect protocol message, issuing user/password if
|
|
// applicable. The lock is assumed to be held upon entering.
|
|
func (nc *Conn) connectProto() (string, error) {
|
|
o := nc.Opts
|
|
var nkey, sig, user, pass, token, ujwt string
|
|
u := nc.current.url.User
|
|
if u != nil {
|
|
// if no password, assume username is authToken
|
|
if _, ok := u.Password(); !ok {
|
|
token = u.Username()
|
|
} else {
|
|
user = u.Username()
|
|
pass, _ = u.Password()
|
|
}
|
|
} else {
|
|
// Take from options (possibly all empty strings)
|
|
user = o.User
|
|
pass = o.Password
|
|
token = o.Token
|
|
nkey = o.Nkey
|
|
}
|
|
|
|
// Look for user jwt.
|
|
if o.UserJWT != nil {
|
|
if jwt, err := o.UserJWT(); err != nil {
|
|
return _EMPTY_, err
|
|
} else {
|
|
ujwt = jwt
|
|
}
|
|
if nkey != _EMPTY_ {
|
|
return _EMPTY_, ErrNkeyAndUser
|
|
}
|
|
}
|
|
|
|
if ujwt != _EMPTY_ || nkey != _EMPTY_ {
|
|
if o.SignatureCB == nil {
|
|
if ujwt == _EMPTY_ {
|
|
return _EMPTY_, ErrNkeyButNoSigCB
|
|
}
|
|
return _EMPTY_, ErrUserButNoSigCB
|
|
}
|
|
sigraw, err := o.SignatureCB([]byte(nc.info.Nonce))
|
|
if err != nil {
|
|
return _EMPTY_, err
|
|
}
|
|
sig = base64.RawURLEncoding.EncodeToString(sigraw)
|
|
}
|
|
|
|
if nc.Opts.TokenHandler != nil {
|
|
if token != _EMPTY_ {
|
|
return _EMPTY_, ErrTokenAlreadySet
|
|
}
|
|
token = nc.Opts.TokenHandler()
|
|
}
|
|
|
|
cinfo := connectInfo{o.Verbose, o.Pedantic, ujwt, nkey, sig, user, pass, token,
|
|
o.Secure, o.Name, LangString, Version, clientProtoInfo, !o.NoEcho}
|
|
|
|
b, err := json.Marshal(cinfo)
|
|
if err != nil {
|
|
return _EMPTY_, ErrJsonParse
|
|
}
|
|
|
|
// Check if NoEcho is set and we have a server that supports it.
|
|
if o.NoEcho && nc.info.Proto < 1 {
|
|
return _EMPTY_, ErrNoEchoNotSupported
|
|
}
|
|
|
|
return fmt.Sprintf(conProto, b), nil
|
|
}
|
|
|
|
// normalizeErr removes the prefix -ERR, trim spaces and remove the quotes.
|
|
func normalizeErr(line string) string {
|
|
s := strings.TrimSpace(strings.TrimPrefix(line, _ERR_OP_))
|
|
s = strings.TrimLeft(strings.TrimRight(s, "'"), "'")
|
|
return s
|
|
}
|
|
|
|
// Send a connect protocol message to the server, issue user/password if
|
|
// applicable. Will wait for a flush to return from the server for error
|
|
// processing.
|
|
func (nc *Conn) sendConnect() error {
|
|
|
|
// Construct the CONNECT protocol string
|
|
cProto, err := nc.connectProto()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// Write the protocol into the buffer
|
|
_, err = nc.bw.WriteString(cProto)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// Add to the buffer the PING protocol
|
|
_, err = nc.bw.WriteString(pingProto)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// Flush the buffer
|
|
err = nc.bw.Flush()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// We don't want to read more than we need here, otherwise
|
|
// we would need to transfer the excess read data to the readLoop.
|
|
// Since in normal situations we just are looking for a PONG\r\n,
|
|
// reading byte-by-byte here is ok.
|
|
proto, err := nc.readProto()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// If opts.Verbose is set, handle +OK
|
|
if nc.Opts.Verbose && proto == okProto {
|
|
// Read the rest now...
|
|
proto, err = nc.readProto()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
}
|
|
|
|
// We expect a PONG
|
|
if proto != pongProto {
|
|
// But it could be something else, like -ERR
|
|
|
|
// Since we no longer use ReadLine(), trim the trailing "\r\n"
|
|
proto = strings.TrimRight(proto, "\r\n")
|
|
|
|
// If it's a server error...
|
|
if strings.HasPrefix(proto, _ERR_OP_) {
|
|
// Remove -ERR, trim spaces and quotes, and convert to lower case.
|
|
proto = normalizeErr(proto)
|
|
return errors.New("nats: " + proto)
|
|
}
|
|
|
|
// Notify that we got an unexpected protocol.
|
|
return fmt.Errorf("nats: expected '%s', got '%s'", _PONG_OP_, proto)
|
|
}
|
|
|
|
// This is where we are truly connected.
|
|
nc.status = CONNECTED
|
|
|
|
return nil
|
|
}
|
|
|
|
// reads a protocol one byte at a time.
|
|
func (nc *Conn) readProto() (string, error) {
|
|
var (
|
|
_buf = [10]byte{}
|
|
buf = _buf[:0]
|
|
b = [1]byte{}
|
|
protoEnd = byte('\n')
|
|
)
|
|
for {
|
|
if _, err := nc.conn.Read(b[:1]); err != nil {
|
|
// Do not report EOF error
|
|
if err == io.EOF {
|
|
return string(buf), nil
|
|
}
|
|
return "", err
|
|
}
|
|
buf = append(buf, b[0])
|
|
if b[0] == protoEnd {
|
|
return string(buf), nil
|
|
}
|
|
}
|
|
}
|
|
|
|
// A control protocol line.
|
|
type control struct {
|
|
op, args string
|
|
}
|
|
|
|
// Read a control line and process the intended op.
|
|
func (nc *Conn) readOp(c *control) error {
|
|
br := bufio.NewReaderSize(nc.conn, defaultBufSize)
|
|
line, err := br.ReadString('\n')
|
|
if err != nil {
|
|
return err
|
|
}
|
|
parseControl(line, c)
|
|
return nil
|
|
}
|
|
|
|
// Parse a control line from the server.
|
|
func parseControl(line string, c *control) {
|
|
toks := strings.SplitN(line, _SPC_, 2)
|
|
if len(toks) == 1 {
|
|
c.op = strings.TrimSpace(toks[0])
|
|
c.args = _EMPTY_
|
|
} else if len(toks) == 2 {
|
|
c.op, c.args = strings.TrimSpace(toks[0]), strings.TrimSpace(toks[1])
|
|
} else {
|
|
c.op = _EMPTY_
|
|
}
|
|
}
|
|
|
|
// flushReconnectPending will push the pending items that were
|
|
// gathered while we were in a RECONNECTING state to the socket.
|
|
func (nc *Conn) flushReconnectPendingItems() {
|
|
if nc.pending == nil {
|
|
return
|
|
}
|
|
if nc.pending.Len() > 0 {
|
|
nc.bw.Write(nc.pending.Bytes())
|
|
}
|
|
}
|
|
|
|
// Stops the ping timer if set.
|
|
// Connection lock is held on entry.
|
|
func (nc *Conn) stopPingTimer() {
|
|
if nc.ptmr != nil {
|
|
nc.ptmr.Stop()
|
|
}
|
|
}
|
|
|
|
// Try to reconnect using the option parameters.
|
|
// This function assumes we are allowed to reconnect.
|
|
func (nc *Conn) doReconnect() {
|
|
// We want to make sure we have the other watchers shutdown properly
|
|
// here before we proceed past this point.
|
|
nc.waitForExits()
|
|
|
|
// FIXME(dlc) - We have an issue here if we have
|
|
// outstanding flush points (pongs) and they were not
|
|
// sent out, but are still in the pipe.
|
|
|
|
// Hold the lock manually and release where needed below,
|
|
// can't do defer here.
|
|
nc.mu.Lock()
|
|
|
|
// Clear any queued pongs, e.g. pending flush calls.
|
|
nc.clearPendingFlushCalls()
|
|
|
|
// Clear any errors.
|
|
nc.err = nil
|
|
// Perform appropriate callback if needed for a disconnect.
|
|
if nc.Opts.DisconnectedCB != nil {
|
|
nc.ach.push(func() { nc.Opts.DisconnectedCB(nc) })
|
|
}
|
|
|
|
// This is used to wait on go routines exit if we start them in the loop
|
|
// but an error occurs after that.
|
|
waitForGoRoutines := false
|
|
|
|
for len(nc.srvPool) > 0 {
|
|
cur, err := nc.selectNextServer()
|
|
if err != nil {
|
|
nc.err = err
|
|
break
|
|
}
|
|
|
|
sleepTime := int64(0)
|
|
|
|
// Sleep appropriate amount of time before the
|
|
// connection attempt if connecting to same server
|
|
// we just got disconnected from..
|
|
if time.Since(cur.lastAttempt) < nc.Opts.ReconnectWait {
|
|
sleepTime = int64(nc.Opts.ReconnectWait - time.Since(cur.lastAttempt))
|
|
}
|
|
|
|
// On Windows, createConn() will take more than a second when no
|
|
// server is running at that address. So it could be that the
|
|
// time elapsed between reconnect attempts is always > than
|
|
// the set option. Release the lock to give a chance to a parallel
|
|
// nc.Close() to break the loop.
|
|
nc.mu.Unlock()
|
|
if sleepTime <= 0 {
|
|
runtime.Gosched()
|
|
} else {
|
|
time.Sleep(time.Duration(sleepTime))
|
|
}
|
|
// If the readLoop, etc.. go routines were started, wait for them to complete.
|
|
if waitForGoRoutines {
|
|
nc.waitForExits()
|
|
waitForGoRoutines = false
|
|
}
|
|
nc.mu.Lock()
|
|
|
|
// Check if we have been closed first.
|
|
if nc.isClosed() {
|
|
break
|
|
}
|
|
|
|
// Mark that we tried a reconnect
|
|
cur.reconnects++
|
|
|
|
// Try to create a new connection
|
|
err = nc.createConn()
|
|
|
|
// Not yet connected, retry...
|
|
// Continue to hold the lock
|
|
if err != nil {
|
|
nc.err = nil
|
|
continue
|
|
}
|
|
|
|
// We are reconnected
|
|
nc.Reconnects++
|
|
|
|
// Process connect logic
|
|
if nc.err = nc.processConnectInit(); nc.err != nil {
|
|
nc.status = RECONNECTING
|
|
// Reset the buffered writer to the pending buffer
|
|
// (was set to a buffered writer on nc.conn in createConn)
|
|
nc.bw.Reset(nc.pending)
|
|
continue
|
|
}
|
|
|
|
// Clear out server stats for the server we connected to..
|
|
cur.didConnect = true
|
|
cur.reconnects = 0
|
|
|
|
// Send existing subscription state
|
|
nc.resendSubscriptions()
|
|
|
|
// Now send off and clear pending buffer
|
|
nc.flushReconnectPendingItems()
|
|
|
|
// Flush the buffer
|
|
nc.err = nc.bw.Flush()
|
|
if nc.err != nil {
|
|
nc.status = RECONNECTING
|
|
// Reset the buffered writer to the pending buffer (bytes.Buffer).
|
|
nc.bw.Reset(nc.pending)
|
|
// Stop the ping timer (if set)
|
|
nc.stopPingTimer()
|
|
// Since processConnectInit() returned without error, the
|
|
// go routines were started, so wait for them to return
|
|
// on the next iteration (after releasing the lock).
|
|
waitForGoRoutines = true
|
|
continue
|
|
}
|
|
|
|
// Done with the pending buffer
|
|
nc.pending = nil
|
|
|
|
// This is where we are truly connected.
|
|
nc.status = CONNECTED
|
|
|
|
// Queue up the reconnect callback.
|
|
if nc.Opts.ReconnectedCB != nil {
|
|
nc.ach.push(func() { nc.Opts.ReconnectedCB(nc) })
|
|
}
|
|
// Release lock here, we will return below.
|
|
nc.mu.Unlock()
|
|
|
|
// Make sure to flush everything
|
|
nc.Flush()
|
|
|
|
return
|
|
}
|
|
|
|
// Call into close.. We have no servers left..
|
|
if nc.err == nil {
|
|
nc.err = ErrNoServers
|
|
}
|
|
nc.mu.Unlock()
|
|
nc.Close()
|
|
}
|
|
|
|
// processOpErr handles errors from reading or parsing the protocol.
|
|
// The lock should not be held entering this function.
|
|
func (nc *Conn) processOpErr(err error) {
|
|
nc.mu.Lock()
|
|
if nc.isConnecting() || nc.isClosed() || nc.isReconnecting() {
|
|
nc.mu.Unlock()
|
|
return
|
|
}
|
|
|
|
if nc.Opts.AllowReconnect && nc.status == CONNECTED {
|
|
// Set our new status
|
|
nc.status = RECONNECTING
|
|
// Stop ping timer if set
|
|
nc.stopPingTimer()
|
|
if nc.conn != nil {
|
|
nc.bw.Flush()
|
|
nc.conn.Close()
|
|
nc.conn = nil
|
|
}
|
|
|
|
// Create pending buffer before reconnecting.
|
|
nc.pending = new(bytes.Buffer)
|
|
nc.bw.Reset(nc.pending)
|
|
|
|
go nc.doReconnect()
|
|
nc.mu.Unlock()
|
|
return
|
|
}
|
|
|
|
nc.status = DISCONNECTED
|
|
nc.err = err
|
|
nc.mu.Unlock()
|
|
nc.Close()
|
|
}
|
|
|
|
// dispatch is responsible for calling any async callbacks
|
|
func (ac *asyncCallbacksHandler) asyncCBDispatcher() {
|
|
for {
|
|
ac.mu.Lock()
|
|
// Protect for spurious wakeups. We should get out of the
|
|
// wait only if there is an element to pop from the list.
|
|
for ac.head == nil {
|
|
ac.cond.Wait()
|
|
}
|
|
cur := ac.head
|
|
ac.head = cur.next
|
|
if cur == ac.tail {
|
|
ac.tail = nil
|
|
}
|
|
ac.mu.Unlock()
|
|
|
|
// This signals that the dispatcher has been closed and all
|
|
// previous callbacks have been dispatched.
|
|
if cur.f == nil {
|
|
return
|
|
}
|
|
// Invoke callback outside of handler's lock
|
|
cur.f()
|
|
}
|
|
}
|
|
|
|
// Add the given function to the tail of the list and
|
|
// signals the dispatcher.
|
|
func (ac *asyncCallbacksHandler) push(f func()) {
|
|
ac.pushOrClose(f, false)
|
|
}
|
|
|
|
// Signals that we are closing...
|
|
func (ac *asyncCallbacksHandler) close() {
|
|
ac.pushOrClose(nil, true)
|
|
}
|
|
|
|
// Add the given function to the tail of the list and
|
|
// signals the dispatcher.
|
|
func (ac *asyncCallbacksHandler) pushOrClose(f func(), close bool) {
|
|
ac.mu.Lock()
|
|
defer ac.mu.Unlock()
|
|
// Make sure that library is not calling push with nil function,
|
|
// since this is used to notify the dispatcher that it should stop.
|
|
if !close && f == nil {
|
|
panic("pushing a nil callback")
|
|
}
|
|
cb := &asyncCB{f: f}
|
|
if ac.tail != nil {
|
|
ac.tail.next = cb
|
|
} else {
|
|
ac.head = cb
|
|
}
|
|
ac.tail = cb
|
|
if close {
|
|
ac.cond.Broadcast()
|
|
} else {
|
|
ac.cond.Signal()
|
|
}
|
|
}
|
|
|
|
// readLoop() will sit on the socket reading and processing the
|
|
// protocol from the server. It will dispatch appropriately based
|
|
// on the op type.
|
|
func (nc *Conn) readLoop() {
|
|
// Release the wait group on exit
|
|
defer nc.wg.Done()
|
|
|
|
// Create a parseState if needed.
|
|
nc.mu.Lock()
|
|
if nc.ps == nil {
|
|
nc.ps = &parseState{}
|
|
}
|
|
nc.mu.Unlock()
|
|
|
|
// Stack based buffer.
|
|
b := make([]byte, defaultBufSize)
|
|
|
|
for {
|
|
// FIXME(dlc): RWLock here?
|
|
nc.mu.Lock()
|
|
sb := nc.isClosed() || nc.isReconnecting()
|
|
if sb {
|
|
nc.ps = &parseState{}
|
|
}
|
|
conn := nc.conn
|
|
nc.mu.Unlock()
|
|
|
|
if sb || conn == nil {
|
|
break
|
|
}
|
|
|
|
n, err := conn.Read(b)
|
|
if err != nil {
|
|
nc.processOpErr(err)
|
|
break
|
|
}
|
|
if err := nc.parse(b[:n]); err != nil {
|
|
nc.processOpErr(err)
|
|
break
|
|
}
|
|
}
|
|
// Clear the parseState here..
|
|
nc.mu.Lock()
|
|
nc.ps = nil
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// waitForMsgs waits on the conditional shared with readLoop and processMsg.
|
|
// It is used to deliver messages to asynchronous subscribers.
|
|
func (nc *Conn) waitForMsgs(s *Subscription) {
|
|
var closed bool
|
|
var delivered, max uint64
|
|
|
|
// Used to account for adjustments to sub.pBytes when we wrap back around.
|
|
msgLen := -1
|
|
|
|
for {
|
|
s.mu.Lock()
|
|
// Do accounting for last msg delivered here so we only lock once
|
|
// and drain state trips after callback has returned.
|
|
if msgLen >= 0 {
|
|
s.pMsgs--
|
|
s.pBytes -= msgLen
|
|
msgLen = -1
|
|
}
|
|
|
|
if s.pHead == nil && !s.closed {
|
|
s.pCond.Wait()
|
|
}
|
|
// Pop the msg off the list
|
|
m := s.pHead
|
|
if m != nil {
|
|
s.pHead = m.next
|
|
if s.pHead == nil {
|
|
s.pTail = nil
|
|
}
|
|
if m.barrier != nil {
|
|
s.mu.Unlock()
|
|
if atomic.AddInt64(&m.barrier.refs, -1) == 0 {
|
|
m.barrier.f()
|
|
}
|
|
continue
|
|
}
|
|
msgLen = len(m.Data)
|
|
}
|
|
mcb := s.mcb
|
|
max = s.max
|
|
closed = s.closed
|
|
if !s.closed {
|
|
s.delivered++
|
|
delivered = s.delivered
|
|
}
|
|
s.mu.Unlock()
|
|
|
|
if closed {
|
|
break
|
|
}
|
|
|
|
// Deliver the message.
|
|
if m != nil && (max == 0 || delivered <= max) {
|
|
mcb(m)
|
|
}
|
|
// If we have hit the max for delivered msgs, remove sub.
|
|
if max > 0 && delivered >= max {
|
|
nc.mu.Lock()
|
|
nc.removeSub(s)
|
|
nc.mu.Unlock()
|
|
break
|
|
}
|
|
}
|
|
// Check for barrier messages
|
|
s.mu.Lock()
|
|
for m := s.pHead; m != nil; m = s.pHead {
|
|
if m.barrier != nil {
|
|
s.mu.Unlock()
|
|
if atomic.AddInt64(&m.barrier.refs, -1) == 0 {
|
|
m.barrier.f()
|
|
}
|
|
s.mu.Lock()
|
|
}
|
|
s.pHead = m.next
|
|
}
|
|
s.mu.Unlock()
|
|
}
|
|
|
|
// processMsg is called by parse and will place the msg on the
|
|
// appropriate channel/pending queue for processing. If the channel is full,
|
|
// or the pending queue is over the pending limits, the connection is
|
|
// considered a slow consumer.
|
|
func (nc *Conn) processMsg(data []byte) {
|
|
// Don't lock the connection to avoid server cutting us off if the
|
|
// flusher is holding the connection lock, trying to send to the server
|
|
// that is itself trying to send data to us.
|
|
nc.subsMu.RLock()
|
|
|
|
// Stats
|
|
nc.InMsgs++
|
|
nc.InBytes += uint64(len(data))
|
|
|
|
sub := nc.subs[nc.ps.ma.sid]
|
|
if sub == nil {
|
|
nc.subsMu.RUnlock()
|
|
return
|
|
}
|
|
|
|
// Copy them into string
|
|
subj := string(nc.ps.ma.subject)
|
|
reply := string(nc.ps.ma.reply)
|
|
|
|
// Doing message create outside of the sub's lock to reduce contention.
|
|
// It's possible that we end-up not using the message, but that's ok.
|
|
|
|
// FIXME(dlc): Need to copy, should/can do COW?
|
|
msgPayload := make([]byte, len(data))
|
|
copy(msgPayload, data)
|
|
|
|
// FIXME(dlc): Should we recycle these containers?
|
|
m := &Msg{Data: msgPayload, Subject: subj, Reply: reply, Sub: sub}
|
|
|
|
sub.mu.Lock()
|
|
|
|
// Subscription internal stats (applicable only for non ChanSubscription's)
|
|
if sub.typ != ChanSubscription {
|
|
sub.pMsgs++
|
|
if sub.pMsgs > sub.pMsgsMax {
|
|
sub.pMsgsMax = sub.pMsgs
|
|
}
|
|
sub.pBytes += len(m.Data)
|
|
if sub.pBytes > sub.pBytesMax {
|
|
sub.pBytesMax = sub.pBytes
|
|
}
|
|
|
|
// Check for a Slow Consumer
|
|
if (sub.pMsgsLimit > 0 && sub.pMsgs > sub.pMsgsLimit) ||
|
|
(sub.pBytesLimit > 0 && sub.pBytes > sub.pBytesLimit) {
|
|
goto slowConsumer
|
|
}
|
|
}
|
|
|
|
// We have two modes of delivery. One is the channel, used by channel
|
|
// subscribers and syncSubscribers, the other is a linked list for async.
|
|
if sub.mch != nil {
|
|
select {
|
|
case sub.mch <- m:
|
|
default:
|
|
goto slowConsumer
|
|
}
|
|
} else {
|
|
// Push onto the async pList
|
|
if sub.pHead == nil {
|
|
sub.pHead = m
|
|
sub.pTail = m
|
|
sub.pCond.Signal()
|
|
} else {
|
|
sub.pTail.next = m
|
|
sub.pTail = m
|
|
}
|
|
}
|
|
|
|
// Clear SlowConsumer status.
|
|
sub.sc = false
|
|
|
|
sub.mu.Unlock()
|
|
nc.subsMu.RUnlock()
|
|
return
|
|
|
|
slowConsumer:
|
|
sub.dropped++
|
|
sc := !sub.sc
|
|
sub.sc = true
|
|
// Undo stats from above
|
|
if sub.typ != ChanSubscription {
|
|
sub.pMsgs--
|
|
sub.pBytes -= len(m.Data)
|
|
}
|
|
sub.mu.Unlock()
|
|
nc.subsMu.RUnlock()
|
|
if sc {
|
|
// Now we need connection's lock and we may end-up in the situation
|
|
// that we were trying to avoid, except that in this case, the client
|
|
// is already experiencing client-side slow consumer situation.
|
|
nc.mu.Lock()
|
|
nc.err = ErrSlowConsumer
|
|
if nc.Opts.AsyncErrorCB != nil {
|
|
nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, sub, ErrSlowConsumer) })
|
|
}
|
|
nc.mu.Unlock()
|
|
}
|
|
}
|
|
|
|
// processPermissionsViolation is called when the server signals a subject
|
|
// permissions violation on either publish or subscribe.
|
|
func (nc *Conn) processPermissionsViolation(err string) {
|
|
nc.mu.Lock()
|
|
// create error here so we can pass it as a closure to the async cb dispatcher.
|
|
e := errors.New("nats: " + err)
|
|
nc.err = e
|
|
if nc.Opts.AsyncErrorCB != nil {
|
|
nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, e) })
|
|
}
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// processAuthorizationViolation is called when the server signals a user
|
|
// authorization violation.
|
|
func (nc *Conn) processAuthorizationViolation(err string) {
|
|
nc.mu.Lock()
|
|
nc.err = ErrAuthorization
|
|
if nc.Opts.AsyncErrorCB != nil {
|
|
nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, ErrAuthorization) })
|
|
}
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// flusher is a separate Go routine that will process flush requests for the write
|
|
// bufio. This allows coalescing of writes to the underlying socket.
|
|
func (nc *Conn) flusher() {
|
|
// Release the wait group
|
|
defer nc.wg.Done()
|
|
|
|
// snapshot the bw and conn since they can change from underneath of us.
|
|
nc.mu.Lock()
|
|
bw := nc.bw
|
|
conn := nc.conn
|
|
fch := nc.fch
|
|
nc.mu.Unlock()
|
|
|
|
if conn == nil || bw == nil {
|
|
return
|
|
}
|
|
|
|
for {
|
|
if _, ok := <-fch; !ok {
|
|
return
|
|
}
|
|
nc.mu.Lock()
|
|
|
|
// Check to see if we should bail out.
|
|
if !nc.isConnected() || nc.isConnecting() || bw != nc.bw || conn != nc.conn {
|
|
nc.mu.Unlock()
|
|
return
|
|
}
|
|
if bw.Buffered() > 0 {
|
|
if err := bw.Flush(); err != nil {
|
|
if nc.err == nil {
|
|
nc.err = err
|
|
}
|
|
}
|
|
}
|
|
nc.mu.Unlock()
|
|
}
|
|
}
|
|
|
|
// processPing will send an immediate pong protocol response to the
|
|
// server. The server uses this mechanism to detect dead clients.
|
|
func (nc *Conn) processPing() {
|
|
nc.sendProto(pongProto)
|
|
}
|
|
|
|
// processPong is used to process responses to the client's ping
|
|
// messages. We use pings for the flush mechanism as well.
|
|
func (nc *Conn) processPong() {
|
|
var ch chan struct{}
|
|
|
|
nc.mu.Lock()
|
|
if len(nc.pongs) > 0 {
|
|
ch = nc.pongs[0]
|
|
nc.pongs = nc.pongs[1:]
|
|
}
|
|
nc.pout = 0
|
|
nc.mu.Unlock()
|
|
if ch != nil {
|
|
ch <- struct{}{}
|
|
}
|
|
}
|
|
|
|
// processOK is a placeholder for processing OK messages.
|
|
func (nc *Conn) processOK() {
|
|
// do nothing
|
|
}
|
|
|
|
// processInfo is used to parse the info messages sent
|
|
// from the server.
|
|
// This function may update the server pool.
|
|
func (nc *Conn) processInfo(info string) error {
|
|
if info == _EMPTY_ {
|
|
return nil
|
|
}
|
|
ncInfo := serverInfo{}
|
|
if err := json.Unmarshal([]byte(info), &ncInfo); err != nil {
|
|
return err
|
|
}
|
|
// Copy content into connection's info structure.
|
|
nc.info = ncInfo
|
|
// The array could be empty/not present on initial connect,
|
|
// if advertise is disabled on that server, or servers that
|
|
// did not include themselves in the async INFO protocol.
|
|
// If empty, do not remove the implicit servers from the pool.
|
|
if len(ncInfo.ConnectURLs) == 0 {
|
|
return nil
|
|
}
|
|
// Note about pool randomization: when the pool was first created,
|
|
// it was randomized (if allowed). We keep the order the same (removing
|
|
// implicit servers that are no longer sent to us). New URLs are sent
|
|
// to us in no specific order so don't need extra randomization.
|
|
hasNew := false
|
|
// This is what we got from the server we are connected to.
|
|
urls := nc.info.ConnectURLs
|
|
// Transform that to a map for easy lookups
|
|
tmp := make(map[string]struct{}, len(urls))
|
|
for _, curl := range urls {
|
|
tmp[curl] = struct{}{}
|
|
}
|
|
// Walk the pool and removed the implicit servers that are no longer in the
|
|
// given array/map
|
|
sp := nc.srvPool
|
|
for i := 0; i < len(sp); i++ {
|
|
srv := sp[i]
|
|
curl := srv.url.Host
|
|
// Check if this URL is in the INFO protocol
|
|
_, inInfo := tmp[curl]
|
|
// Remove from the temp map so that at the end we are left with only
|
|
// new (or restarted) servers that need to be added to the pool.
|
|
delete(tmp, curl)
|
|
// Keep servers that were set through Options, but also the one that
|
|
// we are currently connected to (even if it is a discovered server).
|
|
if !srv.isImplicit || srv.url == nc.current.url {
|
|
continue
|
|
}
|
|
if !inInfo {
|
|
// Remove from server pool. Keep current order.
|
|
copy(sp[i:], sp[i+1:])
|
|
nc.srvPool = sp[:len(sp)-1]
|
|
sp = nc.srvPool
|
|
i--
|
|
}
|
|
}
|
|
// Figure out if we should save off the current non-IP hostname if we encounter a bare IP.
|
|
var saveTLS bool
|
|
if nc.current != nil && nc.Opts.Secure && !hostIsIP(nc.current.url) {
|
|
saveTLS = true
|
|
}
|
|
// If there are any left in the tmp map, these are new (or restarted) servers
|
|
// and need to be added to the pool.
|
|
for curl := range tmp {
|
|
// Before adding, check if this is a new (as in never seen) URL.
|
|
// This is used to figure out if we invoke the DiscoveredServersCB
|
|
if _, present := nc.urls[curl]; !present {
|
|
hasNew = true
|
|
}
|
|
nc.addURLToPool(fmt.Sprintf("%s://%s", nc.connScheme(), curl), true, saveTLS)
|
|
}
|
|
if hasNew && !nc.initc && nc.Opts.DiscoveredServersCB != nil {
|
|
nc.ach.push(func() { nc.Opts.DiscoveredServersCB(nc) })
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
// processAsyncInfo does the same than processInfo, but is called
|
|
// from the parser. Calls processInfo under connection's lock
|
|
// protection.
|
|
func (nc *Conn) processAsyncInfo(info []byte) {
|
|
nc.mu.Lock()
|
|
// Ignore errors, we will simply not update the server pool...
|
|
nc.processInfo(string(info))
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// LastError reports the last error encountered via the connection.
|
|
// It can be used reliably within ClosedCB in order to find out reason
|
|
// why connection was closed for example.
|
|
func (nc *Conn) LastError() error {
|
|
if nc == nil {
|
|
return ErrInvalidConnection
|
|
}
|
|
nc.mu.Lock()
|
|
err := nc.err
|
|
nc.mu.Unlock()
|
|
return err
|
|
}
|
|
|
|
// processErr processes any error messages from the server and
|
|
// sets the connection's lastError.
|
|
func (nc *Conn) processErr(ie string) {
|
|
// Trim, remove quotes
|
|
ne := normalizeErr(ie)
|
|
// convert to lower case.
|
|
e := strings.ToLower(ne)
|
|
|
|
// FIXME(dlc) - process Slow Consumer signals special.
|
|
if e == STALE_CONNECTION {
|
|
nc.processOpErr(ErrStaleConnection)
|
|
} else if strings.HasPrefix(e, PERMISSIONS_ERR) {
|
|
nc.processPermissionsViolation(ne)
|
|
} else if strings.HasPrefix(e, AUTHORIZATION_ERR) {
|
|
nc.processAuthorizationViolation(ne)
|
|
} else {
|
|
nc.mu.Lock()
|
|
nc.err = errors.New("nats: " + ne)
|
|
nc.mu.Unlock()
|
|
nc.Close()
|
|
}
|
|
}
|
|
|
|
// kickFlusher will send a bool on a channel to kick the
|
|
// flush Go routine to flush data to the server.
|
|
func (nc *Conn) kickFlusher() {
|
|
if nc.bw != nil {
|
|
select {
|
|
case nc.fch <- struct{}{}:
|
|
default:
|
|
}
|
|
}
|
|
}
|
|
|
|
// Publish publishes the data argument to the given subject. The data
|
|
// argument is left untouched and needs to be correctly interpreted on
|
|
// the receiver.
|
|
func (nc *Conn) Publish(subj string, data []byte) error {
|
|
return nc.publish(subj, _EMPTY_, data)
|
|
}
|
|
|
|
// PublishMsg publishes the Msg structure, which includes the
|
|
// Subject, an optional Reply and an optional Data field.
|
|
func (nc *Conn) PublishMsg(m *Msg) error {
|
|
if m == nil {
|
|
return ErrInvalidMsg
|
|
}
|
|
return nc.publish(m.Subject, m.Reply, m.Data)
|
|
}
|
|
|
|
// PublishRequest will perform a Publish() excpecting a response on the
|
|
// reply subject. Use Request() for automatically waiting for a response
|
|
// inline.
|
|
func (nc *Conn) PublishRequest(subj, reply string, data []byte) error {
|
|
return nc.publish(subj, reply, data)
|
|
}
|
|
|
|
// Used for handrolled itoa
|
|
const digits = "0123456789"
|
|
|
|
// publish is the internal function to publish messages to a nats-server.
|
|
// Sends a protocol data message by queuing into the bufio writer
|
|
// and kicking the flush go routine. These writes should be protected.
|
|
func (nc *Conn) publish(subj, reply string, data []byte) error {
|
|
if nc == nil {
|
|
return ErrInvalidConnection
|
|
}
|
|
if subj == "" {
|
|
return ErrBadSubject
|
|
}
|
|
nc.mu.Lock()
|
|
|
|
if nc.isClosed() {
|
|
nc.mu.Unlock()
|
|
return ErrConnectionClosed
|
|
}
|
|
|
|
if nc.isDrainingPubs() {
|
|
nc.mu.Unlock()
|
|
return ErrConnectionDraining
|
|
}
|
|
|
|
// Proactively reject payloads over the threshold set by server.
|
|
msgSize := int64(len(data))
|
|
if msgSize > nc.info.MaxPayload {
|
|
nc.mu.Unlock()
|
|
return ErrMaxPayload
|
|
}
|
|
|
|
// Check if we are reconnecting, and if so check if
|
|
// we have exceeded our reconnect outbound buffer limits.
|
|
if nc.isReconnecting() {
|
|
// Flush to underlying buffer.
|
|
nc.bw.Flush()
|
|
// Check if we are over
|
|
if nc.pending.Len() >= nc.Opts.ReconnectBufSize {
|
|
nc.mu.Unlock()
|
|
return ErrReconnectBufExceeded
|
|
}
|
|
}
|
|
|
|
msgh := nc.scratch[:len(_PUB_P_)]
|
|
msgh = append(msgh, subj...)
|
|
msgh = append(msgh, ' ')
|
|
if reply != "" {
|
|
msgh = append(msgh, reply...)
|
|
msgh = append(msgh, ' ')
|
|
}
|
|
|
|
// We could be smarter here, but simple loop is ok,
|
|
// just avoid strconv in fast path
|
|
// FIXME(dlc) - Find a better way here.
|
|
// msgh = strconv.AppendInt(msgh, int64(len(data)), 10)
|
|
|
|
var b [12]byte
|
|
var i = len(b)
|
|
if len(data) > 0 {
|
|
for l := len(data); l > 0; l /= 10 {
|
|
i -= 1
|
|
b[i] = digits[l%10]
|
|
}
|
|
} else {
|
|
i -= 1
|
|
b[i] = digits[0]
|
|
}
|
|
|
|
msgh = append(msgh, b[i:]...)
|
|
msgh = append(msgh, _CRLF_...)
|
|
|
|
_, err := nc.bw.Write(msgh)
|
|
if err == nil {
|
|
_, err = nc.bw.Write(data)
|
|
}
|
|
if err == nil {
|
|
_, err = nc.bw.WriteString(_CRLF_)
|
|
}
|
|
if err != nil {
|
|
nc.mu.Unlock()
|
|
return err
|
|
}
|
|
|
|
nc.OutMsgs++
|
|
nc.OutBytes += uint64(len(data))
|
|
|
|
if len(nc.fch) == 0 {
|
|
nc.kickFlusher()
|
|
}
|
|
nc.mu.Unlock()
|
|
return nil
|
|
}
|
|
|
|
// respHandler is the global response handler. It will look up
|
|
// the appropriate channel based on the last token and place
|
|
// the message on the channel if possible.
|
|
func (nc *Conn) respHandler(m *Msg) {
|
|
rt := respToken(m.Subject)
|
|
|
|
nc.mu.Lock()
|
|
// Just return if closed.
|
|
if nc.isClosed() {
|
|
nc.mu.Unlock()
|
|
return
|
|
}
|
|
|
|
// Grab mch
|
|
mch := nc.respMap[rt]
|
|
// Delete the key regardless, one response only.
|
|
// FIXME(dlc) - should we track responses past 1
|
|
// just statistics wise?
|
|
delete(nc.respMap, rt)
|
|
nc.mu.Unlock()
|
|
|
|
// Don't block, let Request timeout instead, mch is
|
|
// buffered and we should delete the key before a
|
|
// second response is processed.
|
|
select {
|
|
case mch <- m:
|
|
default:
|
|
return
|
|
}
|
|
}
|
|
|
|
// Create the response subscription we will use for all
|
|
// new style responses. This will be on an _INBOX with an
|
|
// additional terminal token. The subscription will be on
|
|
// a wildcard. Caller is responsible for ensuring this is
|
|
// only called once.
|
|
func (nc *Conn) createRespMux(respSub string) error {
|
|
s, err := nc.Subscribe(respSub, nc.respHandler)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
nc.mu.Lock()
|
|
nc.respMux = s
|
|
nc.mu.Unlock()
|
|
return nil
|
|
}
|
|
|
|
// Request will send a request payload and deliver the response message,
|
|
// or an error, including a timeout if no message was received properly.
|
|
func (nc *Conn) Request(subj string, data []byte, timeout time.Duration) (*Msg, error) {
|
|
if nc == nil {
|
|
return nil, ErrInvalidConnection
|
|
}
|
|
|
|
nc.mu.Lock()
|
|
// If user wants the old style.
|
|
if nc.Opts.UseOldRequestStyle {
|
|
nc.mu.Unlock()
|
|
return nc.oldRequest(subj, data, timeout)
|
|
}
|
|
|
|
// Do setup for the new style.
|
|
if nc.respMap == nil {
|
|
nc.initNewResp()
|
|
}
|
|
// Create literal Inbox and map to a chan msg.
|
|
mch := make(chan *Msg, RequestChanLen)
|
|
respInbox := nc.newRespInbox()
|
|
token := respToken(respInbox)
|
|
nc.respMap[token] = mch
|
|
createSub := nc.respMux == nil
|
|
ginbox := nc.respSub
|
|
nc.mu.Unlock()
|
|
|
|
if createSub {
|
|
// Make sure scoped subscription is setup only once.
|
|
var err error
|
|
nc.respSetup.Do(func() { err = nc.createRespMux(ginbox) })
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
}
|
|
|
|
if err := nc.PublishRequest(subj, respInbox, data); err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
t := globalTimerPool.Get(timeout)
|
|
defer globalTimerPool.Put(t)
|
|
|
|
var ok bool
|
|
var msg *Msg
|
|
|
|
select {
|
|
case msg, ok = <-mch:
|
|
if !ok {
|
|
return nil, ErrConnectionClosed
|
|
}
|
|
case <-t.C:
|
|
nc.mu.Lock()
|
|
delete(nc.respMap, token)
|
|
nc.mu.Unlock()
|
|
return nil, ErrTimeout
|
|
}
|
|
|
|
return msg, nil
|
|
}
|
|
|
|
// oldRequest will create an Inbox and perform a Request() call
|
|
// with the Inbox reply and return the first reply received.
|
|
// This is optimized for the case of multiple responses.
|
|
func (nc *Conn) oldRequest(subj string, data []byte, timeout time.Duration) (*Msg, error) {
|
|
inbox := NewInbox()
|
|
ch := make(chan *Msg, RequestChanLen)
|
|
|
|
s, err := nc.subscribe(inbox, _EMPTY_, nil, ch)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
s.AutoUnsubscribe(1)
|
|
defer s.Unsubscribe()
|
|
|
|
err = nc.PublishRequest(subj, inbox, data)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
return s.NextMsg(timeout)
|
|
}
|
|
|
|
// InboxPrefix is the prefix for all inbox subjects.
|
|
const (
|
|
InboxPrefix = "_INBOX."
|
|
inboxPrefixLen = len(InboxPrefix)
|
|
respInboxPrefixLen = inboxPrefixLen + nuidSize + 1
|
|
replySuffixLen = 8 // Gives us 62^8
|
|
rdigits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz"
|
|
base = 62
|
|
)
|
|
|
|
// NewInbox will return an inbox string which can be used for directed replies from
|
|
// subscribers. These are guaranteed to be unique, but can be shared and subscribed
|
|
// to by others.
|
|
func NewInbox() string {
|
|
var b [inboxPrefixLen + nuidSize]byte
|
|
pres := b[:inboxPrefixLen]
|
|
copy(pres, InboxPrefix)
|
|
ns := b[inboxPrefixLen:]
|
|
copy(ns, nuid.Next())
|
|
return string(b[:])
|
|
}
|
|
|
|
// Function to init new response structures.
|
|
func (nc *Conn) initNewResp() {
|
|
// _INBOX wildcard
|
|
nc.respSub = fmt.Sprintf("%s.*", NewInbox())
|
|
nc.respMap = make(map[string]chan *Msg)
|
|
nc.respRand = rand.New(rand.NewSource(time.Now().UnixNano()))
|
|
}
|
|
|
|
// newRespInbox creates a new literal response subject
|
|
// that will trigger the mux subscription handler.
|
|
// Lock should be held.
|
|
func (nc *Conn) newRespInbox() string {
|
|
if nc.respMap == nil {
|
|
nc.initNewResp()
|
|
}
|
|
var b [respInboxPrefixLen + replySuffixLen]byte
|
|
pres := b[:respInboxPrefixLen]
|
|
copy(pres, nc.respSub)
|
|
rn := nc.respRand.Int63()
|
|
for i, l := respInboxPrefixLen, rn; i < len(b); i++ {
|
|
b[i] = rdigits[l%base]
|
|
l /= base
|
|
}
|
|
return string(b[:])
|
|
}
|
|
|
|
// NewRespInbox is the new format used for _INBOX.
|
|
func (nc *Conn) NewRespInbox() string {
|
|
nc.mu.Lock()
|
|
s := nc.newRespInbox()
|
|
nc.mu.Unlock()
|
|
return s
|
|
}
|
|
|
|
// respToken will return the last token of a literal response inbox
|
|
// which we use for the message channel lookup.
|
|
func respToken(respInbox string) string {
|
|
return respInbox[respInboxPrefixLen:]
|
|
}
|
|
|
|
// Subscribe will express interest in the given subject. The subject
|
|
// can have wildcards (partial:*, full:>). Messages will be delivered
|
|
// to the associated MsgHandler.
|
|
func (nc *Conn) Subscribe(subj string, cb MsgHandler) (*Subscription, error) {
|
|
return nc.subscribe(subj, _EMPTY_, cb, nil)
|
|
}
|
|
|
|
// ChanSubscribe will express interest in the given subject and place
|
|
// all messages received on the channel.
|
|
// You should not close the channel until sub.Unsubscribe() has been called.
|
|
func (nc *Conn) ChanSubscribe(subj string, ch chan *Msg) (*Subscription, error) {
|
|
return nc.subscribe(subj, _EMPTY_, nil, ch)
|
|
}
|
|
|
|
// ChanQueueSubscribe will express interest in the given subject.
|
|
// All subscribers with the same queue name will form the queue group
|
|
// and only one member of the group will be selected to receive any given message,
|
|
// which will be placed on the channel.
|
|
// You should not close the channel until sub.Unsubscribe() has been called.
|
|
// Note: This is the same than QueueSubscribeSyncWithChan.
|
|
func (nc *Conn) ChanQueueSubscribe(subj, group string, ch chan *Msg) (*Subscription, error) {
|
|
return nc.subscribe(subj, group, nil, ch)
|
|
}
|
|
|
|
// SubscribeSync will express interest on the given subject. Messages will
|
|
// be received synchronously using Subscription.NextMsg().
|
|
func (nc *Conn) SubscribeSync(subj string) (*Subscription, error) {
|
|
if nc == nil {
|
|
return nil, ErrInvalidConnection
|
|
}
|
|
mch := make(chan *Msg, nc.Opts.SubChanLen)
|
|
s, e := nc.subscribe(subj, _EMPTY_, nil, mch)
|
|
if s != nil {
|
|
s.typ = SyncSubscription
|
|
}
|
|
return s, e
|
|
}
|
|
|
|
// QueueSubscribe creates an asynchronous queue subscriber on the given subject.
|
|
// All subscribers with the same queue name will form the queue group and
|
|
// only one member of the group will be selected to receive any given
|
|
// message asynchronously.
|
|
func (nc *Conn) QueueSubscribe(subj, queue string, cb MsgHandler) (*Subscription, error) {
|
|
return nc.subscribe(subj, queue, cb, nil)
|
|
}
|
|
|
|
// QueueSubscribeSync creates a synchronous queue subscriber on the given
|
|
// subject. All subscribers with the same queue name will form the queue
|
|
// group and only one member of the group will be selected to receive any
|
|
// given message synchronously using Subscription.NextMsg().
|
|
func (nc *Conn) QueueSubscribeSync(subj, queue string) (*Subscription, error) {
|
|
mch := make(chan *Msg, nc.Opts.SubChanLen)
|
|
s, e := nc.subscribe(subj, queue, nil, mch)
|
|
if s != nil {
|
|
s.typ = SyncSubscription
|
|
}
|
|
return s, e
|
|
}
|
|
|
|
// QueueSubscribeSyncWithChan will express interest in the given subject.
|
|
// All subscribers with the same queue name will form the queue group
|
|
// and only one member of the group will be selected to receive any given message,
|
|
// which will be placed on the channel.
|
|
// You should not close the channel until sub.Unsubscribe() has been called.
|
|
// Note: This is the same than ChanQueueSubscribe.
|
|
func (nc *Conn) QueueSubscribeSyncWithChan(subj, queue string, ch chan *Msg) (*Subscription, error) {
|
|
return nc.subscribe(subj, queue, nil, ch)
|
|
}
|
|
|
|
// subscribe is the internal subscribe function that indicates interest in a subject.
|
|
func (nc *Conn) subscribe(subj, queue string, cb MsgHandler, ch chan *Msg) (*Subscription, error) {
|
|
if nc == nil {
|
|
return nil, ErrInvalidConnection
|
|
}
|
|
nc.mu.Lock()
|
|
// ok here, but defer is generally expensive
|
|
defer nc.mu.Unlock()
|
|
|
|
// Check for some error conditions.
|
|
if nc.isClosed() {
|
|
return nil, ErrConnectionClosed
|
|
}
|
|
if nc.isDraining() {
|
|
return nil, ErrConnectionDraining
|
|
}
|
|
|
|
if cb == nil && ch == nil {
|
|
return nil, ErrBadSubscription
|
|
}
|
|
|
|
sub := &Subscription{Subject: subj, Queue: queue, mcb: cb, conn: nc}
|
|
// Set pending limits.
|
|
sub.pMsgsLimit = DefaultSubPendingMsgsLimit
|
|
sub.pBytesLimit = DefaultSubPendingBytesLimit
|
|
|
|
// If we have an async callback, start up a sub specific
|
|
// Go routine to deliver the messages.
|
|
if cb != nil {
|
|
sub.typ = AsyncSubscription
|
|
sub.pCond = sync.NewCond(&sub.mu)
|
|
go nc.waitForMsgs(sub)
|
|
} else {
|
|
sub.typ = ChanSubscription
|
|
sub.mch = ch
|
|
}
|
|
|
|
nc.subsMu.Lock()
|
|
nc.ssid++
|
|
sub.sid = nc.ssid
|
|
nc.subs[sub.sid] = sub
|
|
nc.subsMu.Unlock()
|
|
|
|
// We will send these for all subs when we reconnect
|
|
// so that we can suppress here if reconnecting.
|
|
if !nc.isReconnecting() {
|
|
fmt.Fprintf(nc.bw, subProto, subj, queue, sub.sid)
|
|
// Kick flusher if needed.
|
|
if len(nc.fch) == 0 {
|
|
nc.kickFlusher()
|
|
}
|
|
}
|
|
|
|
return sub, nil
|
|
}
|
|
|
|
// NumSubscriptions returns active number of subscriptions.
|
|
func (nc *Conn) NumSubscriptions() int {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return len(nc.subs)
|
|
}
|
|
|
|
// Lock for nc should be held here upon entry
|
|
func (nc *Conn) removeSub(s *Subscription) {
|
|
nc.subsMu.Lock()
|
|
delete(nc.subs, s.sid)
|
|
nc.subsMu.Unlock()
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
// Release callers on NextMsg for SyncSubscription only
|
|
if s.mch != nil && s.typ == SyncSubscription {
|
|
close(s.mch)
|
|
}
|
|
s.mch = nil
|
|
|
|
// Mark as invalid
|
|
s.conn = nil
|
|
s.closed = true
|
|
if s.pCond != nil {
|
|
s.pCond.Broadcast()
|
|
}
|
|
}
|
|
|
|
// SubscriptionType is the type of the Subscription.
|
|
type SubscriptionType int
|
|
|
|
// The different types of subscription types.
|
|
const (
|
|
AsyncSubscription = SubscriptionType(iota)
|
|
SyncSubscription
|
|
ChanSubscription
|
|
NilSubscription
|
|
)
|
|
|
|
// Type returns the type of Subscription.
|
|
func (s *Subscription) Type() SubscriptionType {
|
|
if s == nil {
|
|
return NilSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
return s.typ
|
|
}
|
|
|
|
// IsValid returns a boolean indicating whether the subscription
|
|
// is still active. This will return false if the subscription has
|
|
// already been closed.
|
|
func (s *Subscription) IsValid() bool {
|
|
if s == nil {
|
|
return false
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
return s.conn != nil
|
|
}
|
|
|
|
// Drain will remove interest but continue callbacks until all messages
|
|
// have been processed.
|
|
func (s *Subscription) Drain() error {
|
|
if s == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
conn := s.conn
|
|
s.mu.Unlock()
|
|
if conn == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
return conn.unsubscribe(s, 0, true)
|
|
}
|
|
|
|
// Unsubscribe will remove interest in the given subject.
|
|
func (s *Subscription) Unsubscribe() error {
|
|
if s == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
conn := s.conn
|
|
s.mu.Unlock()
|
|
if conn == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
if conn.IsDraining() {
|
|
return ErrConnectionDraining
|
|
}
|
|
return conn.unsubscribe(s, 0, false)
|
|
}
|
|
|
|
// checkDrained will watch for a subscription to be fully drained
|
|
// and then remove it.
|
|
func (nc *Conn) checkDrained(sub *Subscription) {
|
|
if nc == nil || sub == nil {
|
|
return
|
|
}
|
|
|
|
// This allows us to know that whatever we have in the client pending
|
|
// is correct and the server will not send additional information.
|
|
nc.Flush()
|
|
|
|
// Once we are here we just wait for Pending to reach 0 or
|
|
// any other state to exit this go routine.
|
|
for {
|
|
// check connection is still valid.
|
|
if nc.IsClosed() {
|
|
return
|
|
}
|
|
|
|
// Check subscription state
|
|
sub.mu.Lock()
|
|
conn := sub.conn
|
|
closed := sub.closed
|
|
pMsgs := sub.pMsgs
|
|
sub.mu.Unlock()
|
|
|
|
if conn == nil || closed || pMsgs == 0 {
|
|
nc.mu.Lock()
|
|
nc.removeSub(sub)
|
|
nc.mu.Unlock()
|
|
return
|
|
}
|
|
|
|
time.Sleep(100 * time.Millisecond)
|
|
}
|
|
}
|
|
|
|
// AutoUnsubscribe will issue an automatic Unsubscribe that is
|
|
// processed by the server when max messages have been received.
|
|
// This can be useful when sending a request to an unknown number
|
|
// of subscribers.
|
|
func (s *Subscription) AutoUnsubscribe(max int) error {
|
|
if s == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
conn := s.conn
|
|
s.mu.Unlock()
|
|
if conn == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
return conn.unsubscribe(s, max, false)
|
|
}
|
|
|
|
// unsubscribe performs the low level unsubscribe to the server.
|
|
// Use Subscription.Unsubscribe()
|
|
func (nc *Conn) unsubscribe(sub *Subscription, max int, drainMode bool) error {
|
|
nc.mu.Lock()
|
|
// ok here, but defer is expensive
|
|
defer nc.mu.Unlock()
|
|
defer nc.kickFlusher()
|
|
|
|
if nc.isClosed() {
|
|
return ErrConnectionClosed
|
|
}
|
|
|
|
nc.subsMu.RLock()
|
|
s := nc.subs[sub.sid]
|
|
nc.subsMu.RUnlock()
|
|
// Already unsubscribed
|
|
if s == nil {
|
|
return nil
|
|
}
|
|
|
|
maxStr := _EMPTY_
|
|
if max > 0 {
|
|
s.max = uint64(max)
|
|
maxStr = strconv.Itoa(max)
|
|
} else if !drainMode {
|
|
nc.removeSub(s)
|
|
}
|
|
|
|
if drainMode {
|
|
go nc.checkDrained(sub)
|
|
}
|
|
|
|
// We will send these for all subs when we reconnect
|
|
// so that we can suppress here.
|
|
if !nc.isReconnecting() {
|
|
fmt.Fprintf(nc.bw, unsubProto, s.sid, maxStr)
|
|
}
|
|
return nil
|
|
}
|
|
|
|
// NextMsg will return the next message available to a synchronous subscriber
|
|
// or block until one is available. A timeout can be used to return when no
|
|
// message has been delivered.
|
|
func (s *Subscription) NextMsg(timeout time.Duration) (*Msg, error) {
|
|
if s == nil {
|
|
return nil, ErrBadSubscription
|
|
}
|
|
|
|
s.mu.Lock()
|
|
err := s.validateNextMsgState()
|
|
if err != nil {
|
|
s.mu.Unlock()
|
|
return nil, err
|
|
}
|
|
|
|
// snapshot
|
|
mch := s.mch
|
|
s.mu.Unlock()
|
|
|
|
var ok bool
|
|
var msg *Msg
|
|
|
|
// If something is available right away, let's optimize that case.
|
|
select {
|
|
case msg, ok = <-mch:
|
|
if !ok {
|
|
return nil, ErrConnectionClosed
|
|
}
|
|
if err := s.processNextMsgDelivered(msg); err != nil {
|
|
return nil, err
|
|
} else {
|
|
return msg, nil
|
|
}
|
|
default:
|
|
}
|
|
|
|
// If we are here a message was not immediately available, so lets loop
|
|
// with a timeout.
|
|
|
|
t := globalTimerPool.Get(timeout)
|
|
defer globalTimerPool.Put(t)
|
|
|
|
select {
|
|
case msg, ok = <-mch:
|
|
if !ok {
|
|
return nil, ErrConnectionClosed
|
|
}
|
|
if err := s.processNextMsgDelivered(msg); err != nil {
|
|
return nil, err
|
|
}
|
|
case <-t.C:
|
|
return nil, ErrTimeout
|
|
}
|
|
|
|
return msg, nil
|
|
}
|
|
|
|
// validateNextMsgState checks whether the subscription is in a valid
|
|
// state to call NextMsg and be delivered another message synchronously.
|
|
// This should be called while holding the lock.
|
|
func (s *Subscription) validateNextMsgState() error {
|
|
if s.connClosed {
|
|
return ErrConnectionClosed
|
|
}
|
|
if s.mch == nil {
|
|
if s.max > 0 && s.delivered >= s.max {
|
|
return ErrMaxMessages
|
|
} else if s.closed {
|
|
return ErrBadSubscription
|
|
}
|
|
}
|
|
if s.mcb != nil {
|
|
return ErrSyncSubRequired
|
|
}
|
|
if s.sc {
|
|
s.sc = false
|
|
return ErrSlowConsumer
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
// processNextMsgDelivered takes a message and applies the needed
|
|
// accounting to the stats from the subscription, returning an
|
|
// error in case we have the maximum number of messages have been
|
|
// delivered already. It should not be called while holding the lock.
|
|
func (s *Subscription) processNextMsgDelivered(msg *Msg) error {
|
|
s.mu.Lock()
|
|
nc := s.conn
|
|
max := s.max
|
|
|
|
// Update some stats.
|
|
s.delivered++
|
|
delivered := s.delivered
|
|
if s.typ == SyncSubscription {
|
|
s.pMsgs--
|
|
s.pBytes -= len(msg.Data)
|
|
}
|
|
s.mu.Unlock()
|
|
|
|
if max > 0 {
|
|
if delivered > max {
|
|
return ErrMaxMessages
|
|
}
|
|
// Remove subscription if we have reached max.
|
|
if delivered == max {
|
|
nc.mu.Lock()
|
|
nc.removeSub(s)
|
|
nc.mu.Unlock()
|
|
}
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
// Queued returns the number of queued messages in the client for this subscription.
|
|
// DEPRECATED: Use Pending()
|
|
func (s *Subscription) QueuedMsgs() (int, error) {
|
|
m, _, err := s.Pending()
|
|
return int(m), err
|
|
}
|
|
|
|
// Pending returns the number of queued messages and queued bytes in the client for this subscription.
|
|
func (s *Subscription) Pending() (int, int, error) {
|
|
if s == nil {
|
|
return -1, -1, ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
if s.conn == nil {
|
|
return -1, -1, ErrBadSubscription
|
|
}
|
|
if s.typ == ChanSubscription {
|
|
return -1, -1, ErrTypeSubscription
|
|
}
|
|
return s.pMsgs, s.pBytes, nil
|
|
}
|
|
|
|
// MaxPending returns the maximum number of queued messages and queued bytes seen so far.
|
|
func (s *Subscription) MaxPending() (int, int, error) {
|
|
if s == nil {
|
|
return -1, -1, ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
if s.conn == nil {
|
|
return -1, -1, ErrBadSubscription
|
|
}
|
|
if s.typ == ChanSubscription {
|
|
return -1, -1, ErrTypeSubscription
|
|
}
|
|
return s.pMsgsMax, s.pBytesMax, nil
|
|
}
|
|
|
|
// ClearMaxPending resets the maximums seen so far.
|
|
func (s *Subscription) ClearMaxPending() error {
|
|
if s == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
if s.conn == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
if s.typ == ChanSubscription {
|
|
return ErrTypeSubscription
|
|
}
|
|
s.pMsgsMax, s.pBytesMax = 0, 0
|
|
return nil
|
|
}
|
|
|
|
// Pending Limits
|
|
const (
|
|
DefaultSubPendingMsgsLimit = 65536
|
|
DefaultSubPendingBytesLimit = 65536 * 1024
|
|
)
|
|
|
|
// PendingLimits returns the current limits for this subscription.
|
|
// If no error is returned, a negative value indicates that the
|
|
// given metric is not limited.
|
|
func (s *Subscription) PendingLimits() (int, int, error) {
|
|
if s == nil {
|
|
return -1, -1, ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
if s.conn == nil {
|
|
return -1, -1, ErrBadSubscription
|
|
}
|
|
if s.typ == ChanSubscription {
|
|
return -1, -1, ErrTypeSubscription
|
|
}
|
|
return s.pMsgsLimit, s.pBytesLimit, nil
|
|
}
|
|
|
|
// SetPendingLimits sets the limits for pending msgs and bytes for this subscription.
|
|
// Zero is not allowed. Any negative value means that the given metric is not limited.
|
|
func (s *Subscription) SetPendingLimits(msgLimit, bytesLimit int) error {
|
|
if s == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
if s.conn == nil {
|
|
return ErrBadSubscription
|
|
}
|
|
if s.typ == ChanSubscription {
|
|
return ErrTypeSubscription
|
|
}
|
|
if msgLimit == 0 || bytesLimit == 0 {
|
|
return ErrInvalidArg
|
|
}
|
|
s.pMsgsLimit, s.pBytesLimit = msgLimit, bytesLimit
|
|
return nil
|
|
}
|
|
|
|
// Delivered returns the number of delivered messages for this subscription.
|
|
func (s *Subscription) Delivered() (int64, error) {
|
|
if s == nil {
|
|
return -1, ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
if s.conn == nil {
|
|
return -1, ErrBadSubscription
|
|
}
|
|
return int64(s.delivered), nil
|
|
}
|
|
|
|
// Dropped returns the number of known dropped messages for this subscription.
|
|
// This will correspond to messages dropped by violations of PendingLimits. If
|
|
// the server declares the connection a SlowConsumer, this number may not be
|
|
// valid.
|
|
func (s *Subscription) Dropped() (int, error) {
|
|
if s == nil {
|
|
return -1, ErrBadSubscription
|
|
}
|
|
s.mu.Lock()
|
|
defer s.mu.Unlock()
|
|
if s.conn == nil {
|
|
return -1, ErrBadSubscription
|
|
}
|
|
return s.dropped, nil
|
|
}
|
|
|
|
// FIXME: This is a hack
|
|
// removeFlushEntry is needed when we need to discard queued up responses
|
|
// for our pings as part of a flush call. This happens when we have a flush
|
|
// call outstanding and we call close.
|
|
func (nc *Conn) removeFlushEntry(ch chan struct{}) bool {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
if nc.pongs == nil {
|
|
return false
|
|
}
|
|
for i, c := range nc.pongs {
|
|
if c == ch {
|
|
nc.pongs[i] = nil
|
|
return true
|
|
}
|
|
}
|
|
return false
|
|
}
|
|
|
|
// The lock must be held entering this function.
|
|
func (nc *Conn) sendPing(ch chan struct{}) {
|
|
nc.pongs = append(nc.pongs, ch)
|
|
nc.bw.WriteString(pingProto)
|
|
// Flush in place.
|
|
nc.bw.Flush()
|
|
}
|
|
|
|
// This will fire periodically and send a client origin
|
|
// ping to the server. Will also check that we have received
|
|
// responses from the server.
|
|
func (nc *Conn) processPingTimer() {
|
|
nc.mu.Lock()
|
|
|
|
if nc.status != CONNECTED {
|
|
nc.mu.Unlock()
|
|
return
|
|
}
|
|
|
|
// Check for violation
|
|
nc.pout++
|
|
if nc.pout > nc.Opts.MaxPingsOut {
|
|
nc.mu.Unlock()
|
|
nc.processOpErr(ErrStaleConnection)
|
|
return
|
|
}
|
|
|
|
nc.sendPing(nil)
|
|
nc.ptmr.Reset(nc.Opts.PingInterval)
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// FlushTimeout allows a Flush operation to have an associated timeout.
|
|
func (nc *Conn) FlushTimeout(timeout time.Duration) (err error) {
|
|
if nc == nil {
|
|
return ErrInvalidConnection
|
|
}
|
|
if timeout <= 0 {
|
|
return ErrBadTimeout
|
|
}
|
|
|
|
nc.mu.Lock()
|
|
if nc.isClosed() {
|
|
nc.mu.Unlock()
|
|
return ErrConnectionClosed
|
|
}
|
|
t := globalTimerPool.Get(timeout)
|
|
defer globalTimerPool.Put(t)
|
|
|
|
// Create a buffered channel to prevent chan send to block
|
|
// in processPong() if this code here times out just when
|
|
// PONG was received.
|
|
ch := make(chan struct{}, 1)
|
|
nc.sendPing(ch)
|
|
nc.mu.Unlock()
|
|
|
|
select {
|
|
case _, ok := <-ch:
|
|
if !ok {
|
|
err = ErrConnectionClosed
|
|
} else {
|
|
close(ch)
|
|
}
|
|
case <-t.C:
|
|
err = ErrTimeout
|
|
}
|
|
|
|
if err != nil {
|
|
nc.removeFlushEntry(ch)
|
|
}
|
|
return
|
|
}
|
|
|
|
// Flush will perform a round trip to the server and return when it
|
|
// receives the internal reply.
|
|
func (nc *Conn) Flush() error {
|
|
return nc.FlushTimeout(60 * time.Second)
|
|
}
|
|
|
|
// Buffered will return the number of bytes buffered to be sent to the server.
|
|
// FIXME(dlc) take into account disconnected state.
|
|
func (nc *Conn) Buffered() (int, error) {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
if nc.isClosed() || nc.bw == nil {
|
|
return -1, ErrConnectionClosed
|
|
}
|
|
return nc.bw.Buffered(), nil
|
|
}
|
|
|
|
// resendSubscriptions will send our subscription state back to the
|
|
// server. Used in reconnects
|
|
func (nc *Conn) resendSubscriptions() {
|
|
// Since we are going to send protocols to the server, we don't want to
|
|
// be holding the subsMu lock (which is used in processMsg). So copy
|
|
// the subscriptions in a temporary array.
|
|
nc.subsMu.RLock()
|
|
subs := make([]*Subscription, 0, len(nc.subs))
|
|
for _, s := range nc.subs {
|
|
subs = append(subs, s)
|
|
}
|
|
nc.subsMu.RUnlock()
|
|
for _, s := range subs {
|
|
adjustedMax := uint64(0)
|
|
s.mu.Lock()
|
|
if s.max > 0 {
|
|
if s.delivered < s.max {
|
|
adjustedMax = s.max - s.delivered
|
|
}
|
|
// adjustedMax could be 0 here if the number of delivered msgs
|
|
// reached the max, if so unsubscribe.
|
|
if adjustedMax == 0 {
|
|
s.mu.Unlock()
|
|
fmt.Fprintf(nc.bw, unsubProto, s.sid, _EMPTY_)
|
|
continue
|
|
}
|
|
}
|
|
s.mu.Unlock()
|
|
|
|
fmt.Fprintf(nc.bw, subProto, s.Subject, s.Queue, s.sid)
|
|
if adjustedMax > 0 {
|
|
maxStr := strconv.Itoa(int(adjustedMax))
|
|
fmt.Fprintf(nc.bw, unsubProto, s.sid, maxStr)
|
|
}
|
|
}
|
|
}
|
|
|
|
// This will clear any pending flush calls and release pending calls.
|
|
// Lock is assumed to be held by the caller.
|
|
func (nc *Conn) clearPendingFlushCalls() {
|
|
// Clear any queued pongs, e.g. pending flush calls.
|
|
for _, ch := range nc.pongs {
|
|
if ch != nil {
|
|
close(ch)
|
|
}
|
|
}
|
|
nc.pongs = nil
|
|
}
|
|
|
|
// This will clear any pending Request calls.
|
|
// Lock is assumed to be held by the caller.
|
|
func (nc *Conn) clearPendingRequestCalls() {
|
|
if nc.respMap == nil {
|
|
return
|
|
}
|
|
for key, ch := range nc.respMap {
|
|
if ch != nil {
|
|
close(ch)
|
|
delete(nc.respMap, key)
|
|
}
|
|
}
|
|
}
|
|
|
|
// Low level close call that will do correct cleanup and set
|
|
// desired status. Also controls whether user defined callbacks
|
|
// will be triggered. The lock should not be held entering this
|
|
// function. This function will handle the locking manually.
|
|
func (nc *Conn) close(status Status, doCBs bool) {
|
|
nc.mu.Lock()
|
|
if nc.isClosed() {
|
|
nc.status = status
|
|
nc.mu.Unlock()
|
|
return
|
|
}
|
|
nc.status = CLOSED
|
|
|
|
// Kick the Go routines so they fall out.
|
|
nc.kickFlusher()
|
|
nc.mu.Unlock()
|
|
|
|
nc.mu.Lock()
|
|
|
|
// Clear any queued pongs, e.g. pending flush calls.
|
|
nc.clearPendingFlushCalls()
|
|
|
|
// Clear any queued and blocking Requests.
|
|
nc.clearPendingRequestCalls()
|
|
|
|
// Stop ping timer if set.
|
|
nc.stopPingTimer()
|
|
nc.ptmr = nil
|
|
|
|
// Go ahead and make sure we have flushed the outbound
|
|
if nc.conn != nil {
|
|
nc.bw.Flush()
|
|
defer nc.conn.Close()
|
|
}
|
|
|
|
// Close sync subscriber channels and release any
|
|
// pending NextMsg() calls.
|
|
nc.subsMu.Lock()
|
|
for _, s := range nc.subs {
|
|
s.mu.Lock()
|
|
|
|
// Release callers on NextMsg for SyncSubscription only
|
|
if s.mch != nil && s.typ == SyncSubscription {
|
|
close(s.mch)
|
|
}
|
|
s.mch = nil
|
|
// Mark as invalid, for signaling to deliverMsgs
|
|
s.closed = true
|
|
// Mark connection closed in subscription
|
|
s.connClosed = true
|
|
// If we have an async subscription, signals it to exit
|
|
if s.typ == AsyncSubscription && s.pCond != nil {
|
|
s.pCond.Signal()
|
|
}
|
|
|
|
s.mu.Unlock()
|
|
}
|
|
nc.subs = nil
|
|
nc.subsMu.Unlock()
|
|
|
|
nc.status = status
|
|
|
|
// Perform appropriate callback if needed for a disconnect.
|
|
if doCBs {
|
|
if nc.Opts.DisconnectedCB != nil && nc.conn != nil {
|
|
nc.ach.push(func() { nc.Opts.DisconnectedCB(nc) })
|
|
}
|
|
if nc.Opts.ClosedCB != nil {
|
|
nc.ach.push(func() { nc.Opts.ClosedCB(nc) })
|
|
}
|
|
nc.ach.close()
|
|
}
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// Close will close the connection to the server. This call will release
|
|
// all blocking calls, such as Flush() and NextMsg()
|
|
func (nc *Conn) Close() {
|
|
nc.close(CLOSED, true)
|
|
}
|
|
|
|
// IsClosed tests if a Conn has been closed.
|
|
func (nc *Conn) IsClosed() bool {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.isClosed()
|
|
}
|
|
|
|
// IsReconnecting tests if a Conn is reconnecting.
|
|
func (nc *Conn) IsReconnecting() bool {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.isReconnecting()
|
|
}
|
|
|
|
// IsConnected tests if a Conn is connected.
|
|
func (nc *Conn) IsConnected() bool {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.isConnected()
|
|
}
|
|
|
|
// drainConnection will run in a separate Go routine and will
|
|
// flush all publishes and drain all active subscriptions.
|
|
func (nc *Conn) drainConnection() {
|
|
// Snapshot subs list.
|
|
nc.mu.Lock()
|
|
subs := make([]*Subscription, 0, len(nc.subs))
|
|
for _, s := range nc.subs {
|
|
subs = append(subs, s)
|
|
}
|
|
errCB := nc.Opts.AsyncErrorCB
|
|
drainWait := nc.Opts.DrainTimeout
|
|
nc.mu.Unlock()
|
|
|
|
// for pushing errors with context.
|
|
pushErr := func(err error) {
|
|
nc.mu.Lock()
|
|
nc.err = err
|
|
if errCB != nil {
|
|
nc.ach.push(func() { errCB(nc, nil, err) })
|
|
}
|
|
nc.mu.Unlock()
|
|
}
|
|
|
|
// Do subs first
|
|
for _, s := range subs {
|
|
if err := s.Drain(); err != nil {
|
|
// We will notify about these but continue.
|
|
pushErr(err)
|
|
}
|
|
}
|
|
|
|
// Wait for the subscriptions to drop to zero.
|
|
timeout := time.Now().Add(drainWait)
|
|
for time.Now().Before(timeout) {
|
|
if nc.NumSubscriptions() == 0 {
|
|
break
|
|
}
|
|
time.Sleep(10 * time.Millisecond)
|
|
}
|
|
|
|
// Check if we timed out.
|
|
if nc.NumSubscriptions() != 0 {
|
|
pushErr(ErrDrainTimeout)
|
|
}
|
|
|
|
// Flip State
|
|
nc.mu.Lock()
|
|
nc.status = DRAINING_PUBS
|
|
nc.mu.Unlock()
|
|
|
|
// Do publish drain via Flush() call.
|
|
err := nc.Flush()
|
|
if err != nil {
|
|
pushErr(err)
|
|
nc.Close()
|
|
return
|
|
}
|
|
|
|
// Move to closed state.
|
|
nc.Close()
|
|
}
|
|
|
|
// Drain will put a connection into a drain state. All subscriptions will
|
|
// immediately be put into a drain state. Upon completion, the publishers
|
|
// will be drained and can not publish any additional messages. Upon draining
|
|
// of the publishers, the connection will be closed. Use the ClosedCB()
|
|
// option to know when the connection has moved from draining to closed.
|
|
func (nc *Conn) Drain() error {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
|
|
if nc.isClosed() {
|
|
return ErrConnectionClosed
|
|
}
|
|
if nc.isConnecting() || nc.isReconnecting() {
|
|
return ErrConnectionReconnecting
|
|
}
|
|
if nc.isDraining() {
|
|
return nil
|
|
}
|
|
|
|
nc.status = DRAINING_SUBS
|
|
go nc.drainConnection()
|
|
return nil
|
|
}
|
|
|
|
// IsDraining tests if a Conn is in the draining state.
|
|
func (nc *Conn) IsDraining() bool {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.isDraining()
|
|
}
|
|
|
|
// caller must lock
|
|
func (nc *Conn) getServers(implicitOnly bool) []string {
|
|
poolSize := len(nc.srvPool)
|
|
var servers = make([]string, 0)
|
|
for i := 0; i < poolSize; i++ {
|
|
if implicitOnly && !nc.srvPool[i].isImplicit {
|
|
continue
|
|
}
|
|
url := nc.srvPool[i].url
|
|
servers = append(servers, fmt.Sprintf("%s://%s", url.Scheme, url.Host))
|
|
}
|
|
return servers
|
|
}
|
|
|
|
// Servers returns the list of known server urls, including additional
|
|
// servers discovered after a connection has been established. If
|
|
// authentication is enabled, use UserInfo or Token when connecting with
|
|
// these urls.
|
|
func (nc *Conn) Servers() []string {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.getServers(false)
|
|
}
|
|
|
|
// DiscoveredServers returns only the server urls that have been discovered
|
|
// after a connection has been established. If authentication is enabled,
|
|
// use UserInfo or Token when connecting with these urls.
|
|
func (nc *Conn) DiscoveredServers() []string {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.getServers(true)
|
|
}
|
|
|
|
// Status returns the current state of the connection.
|
|
func (nc *Conn) Status() Status {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.status
|
|
}
|
|
|
|
// Test if Conn has been closed Lock is assumed held.
|
|
func (nc *Conn) isClosed() bool {
|
|
return nc.status == CLOSED
|
|
}
|
|
|
|
// Test if Conn is in the process of connecting
|
|
func (nc *Conn) isConnecting() bool {
|
|
return nc.status == CONNECTING
|
|
}
|
|
|
|
// Test if Conn is being reconnected.
|
|
func (nc *Conn) isReconnecting() bool {
|
|
return nc.status == RECONNECTING
|
|
}
|
|
|
|
// Test if Conn is connected or connecting.
|
|
func (nc *Conn) isConnected() bool {
|
|
return nc.status == CONNECTED || nc.isDraining()
|
|
}
|
|
|
|
// Test if Conn is in the draining state.
|
|
func (nc *Conn) isDraining() bool {
|
|
return nc.status == DRAINING_SUBS || nc.status == DRAINING_PUBS
|
|
}
|
|
|
|
// Test if Conn is in the draining state for pubs.
|
|
func (nc *Conn) isDrainingPubs() bool {
|
|
return nc.status == DRAINING_PUBS
|
|
}
|
|
|
|
// Stats will return a race safe copy of the Statistics section for the connection.
|
|
func (nc *Conn) Stats() Statistics {
|
|
// Stats are updated either under connection's mu or subsMu mutexes.
|
|
// Lock both to safely get them.
|
|
nc.mu.Lock()
|
|
nc.subsMu.RLock()
|
|
stats := Statistics{
|
|
InMsgs: nc.InMsgs,
|
|
InBytes: nc.InBytes,
|
|
OutMsgs: nc.OutMsgs,
|
|
OutBytes: nc.OutBytes,
|
|
Reconnects: nc.Reconnects,
|
|
}
|
|
nc.subsMu.RUnlock()
|
|
nc.mu.Unlock()
|
|
return stats
|
|
}
|
|
|
|
// MaxPayload returns the size limit that a message payload can have.
|
|
// This is set by the server configuration and delivered to the client
|
|
// upon connect.
|
|
func (nc *Conn) MaxPayload() int64 {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.info.MaxPayload
|
|
}
|
|
|
|
// AuthRequired will return if the connected server requires authorization.
|
|
func (nc *Conn) AuthRequired() bool {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.info.AuthRequired
|
|
}
|
|
|
|
// TLSRequired will return if the connected server requires TLS connections.
|
|
func (nc *Conn) TLSRequired() bool {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
return nc.info.TLSRequired
|
|
}
|
|
|
|
// Barrier schedules the given function `f` to all registered asynchronous
|
|
// subscriptions.
|
|
// Only the last subscription to see this barrier will invoke the function.
|
|
// If no subscription is registered at the time of this call, `f()` is invoked
|
|
// right away.
|
|
// ErrConnectionClosed is returned if the connection is closed prior to
|
|
// the call.
|
|
func (nc *Conn) Barrier(f func()) error {
|
|
nc.mu.Lock()
|
|
if nc.isClosed() {
|
|
nc.mu.Unlock()
|
|
return ErrConnectionClosed
|
|
}
|
|
nc.subsMu.Lock()
|
|
// Need to figure out how many non chan subscriptions there are
|
|
numSubs := 0
|
|
for _, sub := range nc.subs {
|
|
if sub.typ == AsyncSubscription {
|
|
numSubs++
|
|
}
|
|
}
|
|
if numSubs == 0 {
|
|
nc.subsMu.Unlock()
|
|
nc.mu.Unlock()
|
|
f()
|
|
return nil
|
|
}
|
|
barrier := &barrierInfo{refs: int64(numSubs), f: f}
|
|
for _, sub := range nc.subs {
|
|
sub.mu.Lock()
|
|
if sub.mch == nil {
|
|
msg := &Msg{barrier: barrier}
|
|
// Push onto the async pList
|
|
if sub.pTail != nil {
|
|
sub.pTail.next = msg
|
|
} else {
|
|
sub.pHead = msg
|
|
sub.pCond.Signal()
|
|
}
|
|
sub.pTail = msg
|
|
}
|
|
sub.mu.Unlock()
|
|
}
|
|
nc.subsMu.Unlock()
|
|
nc.mu.Unlock()
|
|
return nil
|
|
}
|
|
|
|
// GetClientID returns the client ID assigned by the server to which
|
|
// the client is currently connected to. Note that the value may change if
|
|
// the client reconnects.
|
|
// This function returns ErrNoClientIDReturned if the server is of a
|
|
// version prior to 1.2.0.
|
|
func (nc *Conn) GetClientID() (uint64, error) {
|
|
nc.mu.Lock()
|
|
defer nc.mu.Unlock()
|
|
if nc.isClosed() {
|
|
return 0, ErrConnectionClosed
|
|
}
|
|
if nc.info.CID == 0 {
|
|
return 0, ErrClientIDNotSupported
|
|
}
|
|
return nc.info.CID, nil
|
|
}
|
|
|
|
// NkeyOptionFromSeed will load an nkey pair from a seed file.
|
|
// It will return the NKey Option and will handle
|
|
// signing of nonce challenges from the server. It will take
|
|
// care to not hold keys in memory and to wipe memory.
|
|
func NkeyOptionFromSeed(seedFile string) (Option, error) {
|
|
kp, err := nkeyPairFromSeedFile(seedFile)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
// Wipe our key on exit.
|
|
defer kp.Wipe()
|
|
|
|
pub, err := kp.PublicKey()
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
if !nkeys.IsValidPublicUserKey(pub) {
|
|
return nil, fmt.Errorf("nats: Not a valid nkey user seed")
|
|
}
|
|
sigCB := func(nonce []byte) ([]byte, error) {
|
|
return sigHandler(nonce, seedFile)
|
|
}
|
|
return Nkey(string(pub), sigCB), nil
|
|
}
|
|
|
|
// This is a regex to match decorated jwts in keys/seeds.
|
|
// .e.g.
|
|
// -----BEGIN NATS USER JWT-----
|
|
// eyJ0eXAiOiJqd3QiLCJhbGciOiJlZDI1NTE5...
|
|
// ------END NATS USER JWT------
|
|
//
|
|
// ************************* IMPORTANT *************************
|
|
// NKEY Seed printed below can be used sign and prove identity.
|
|
// NKEYs are sensitive and should be treated as secrets.
|
|
//
|
|
// -----BEGIN USER NKEY SEED-----
|
|
// SUAIO3FHUX5PNV2LQIIP7TZ3N4L7TX3W53MQGEIVYFIGA635OZCKEYHFLM
|
|
// ------END USER NKEY SEED------
|
|
|
|
var nscDecoratedRe = regexp.MustCompile(`\s*(?:(?:[-]{3,}[^\n]*[-]{3,}\n)(.+)(?:\n\s*[-]{3,}[^\n]*[-]{3,}\n))`)
|
|
|
|
func userFromFile(userFile string) (string, error) {
|
|
contents, err := ioutil.ReadFile(userFile)
|
|
if err != nil {
|
|
return _EMPTY_, fmt.Errorf("nats: %v", err)
|
|
}
|
|
defer wipeSlice(contents)
|
|
|
|
items := nscDecoratedRe.FindAllSubmatch(contents, -1)
|
|
if len(items) == 0 {
|
|
return string(contents), nil
|
|
}
|
|
// First result should be the user JWT.
|
|
// We copy here so that if the file contained a seed file too we wipe appropriately.
|
|
raw := items[0][1]
|
|
tmp := make([]byte, len(raw))
|
|
copy(tmp, raw)
|
|
return string(tmp), nil
|
|
}
|
|
|
|
func nkeyPairFromSeedFile(seedFile string) (nkeys.KeyPair, error) {
|
|
var seed []byte
|
|
contents, err := ioutil.ReadFile(seedFile)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("nats: %v", err)
|
|
}
|
|
defer wipeSlice(contents)
|
|
|
|
items := nscDecoratedRe.FindAllSubmatch(contents, -1)
|
|
if len(items) > 1 {
|
|
seed = items[1][1]
|
|
} else {
|
|
lines := bytes.Split(contents, []byte("\n"))
|
|
for _, line := range lines {
|
|
if bytes.HasPrefix(bytes.TrimSpace(line), []byte("SU")) {
|
|
seed = line
|
|
break
|
|
}
|
|
}
|
|
}
|
|
|
|
if seed == nil {
|
|
return nil, fmt.Errorf("nats: No nkey user seed found in %q", seedFile)
|
|
}
|
|
kp, err := nkeys.FromSeed(seed)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
return kp, nil
|
|
}
|
|
|
|
// Sign authentication challenges from the server.
|
|
// Do not keep private seed in memory.
|
|
func sigHandler(nonce []byte, seedFile string) ([]byte, error) {
|
|
kp, err := nkeyPairFromSeedFile(seedFile)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
// Wipe our key on exit.
|
|
defer kp.Wipe()
|
|
|
|
sig, _ := kp.Sign(nonce)
|
|
return sig, nil
|
|
}
|
|
|
|
// Just wipe slice with 'x', for clearing contents of nkey seed file.
|
|
func wipeSlice(buf []byte) {
|
|
for i := range buf {
|
|
buf[i] = 'x'
|
|
}
|
|
}
|
|
|
|
type timeoutWriter struct {
|
|
timeout time.Duration
|
|
conn net.Conn
|
|
err error
|
|
}
|
|
|
|
// Write implements the io.Writer interface.
|
|
func (tw *timeoutWriter) Write(p []byte) (int, error) {
|
|
if tw.err != nil {
|
|
return 0, tw.err
|
|
}
|
|
|
|
var n int
|
|
tw.conn.SetWriteDeadline(time.Now().Add(tw.timeout))
|
|
n, tw.err = tw.conn.Write(p)
|
|
tw.conn.SetWriteDeadline(time.Time{})
|
|
return n, tw.err
|
|
}
|